Siamenoside I


title: "Siamenoside I" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["triterpene-glycosides", "sugar-substitutes"] topic_path: "general/triterpene-glycosides" source: "https://en.wikipedia.org/wiki/Siamenoside_I" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| verifiedrevid = 430182933 | Name = Siamenoside I | ImageFile = Siamenosid I.svg | ImageName = Chemical structure of siamenoside I | ImageAlt = Chemical structure of siamenoside I | IUPACName = | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 126105-12-2 | CASNoOther = | UNII_Ref = | UNII = L34LUJ2UPB | PubChem = 71307460 | ChemSpiderID = 24534173 | SMILES = CC@H[C@H]4CC[C@@]5([C@@]4(CC@HO)C)C | StdInChI = 1S/C54H92O24/c1-22(23-15-16-52(6)30-12-10-24-25(54(30,8)31(58)17-53(23,52)7)11-14-32(50(24,2)3)76-47-43(68)39(64)35(60)27(19-56)73-47)9-13-33(51(4,5)70)77-49-45(78-48-44(69)40(65)36(61)28(20-57)74-48)41(66)37(62)29(75-49)21-71-46-42(67)38(63)34(59)26(18-55)72-46/h10,22-23,25-49,55-70H,9,11-21H2,1-8H3/t22-,23-,25-,26-,27-,28-,29-,30-,31-,32+,33-,34-,35-,36-,37-,38+,39+,40+,41+,42-,43-,44-,45-,46-,47+,48+,49+,52+,53-,54+/m1/s1 | StdInChIKey = XJIPREFALCDWRQ-KGFBLRRZSA-N | MeSHName = |Section2={{Chembox Properties | Formula = C54H92O24 | MolarMass = 1125.29 g/mol | Appearance = white powder | Density = | MeltingPt = | BoilingPt = | Solubility = Siamenoside is a cucurbitane, a natural sweetener from the fruit of Siraitia grosvenorii combined with neomogroside. The mixture is about 300 times sweeter than sucrose. It is used as a natural sweetener in China.

References

References

  1. [http://www.chromadex.com/chemicals/Siamenosidei_P.html Siamenoside I] on www.chromadex.com

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

triterpene-glycosidessugar-substitutes