Sesamin

Quality 0.50 · 1 view · Updated 2 months ago

title: "Sesamin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["cyp3a4-inhibitors", "phenol-antioxidants", "lignans", "benzodioxoles", "sesame", "cyp2c9-inhibitors"] topic_path: "general/cyp3a4-inhibitors" source: "https://en.wikipedia.org/wiki/Sesamin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 408462978 | ImageFile = Sesamin acsv.svg | ImageSize = | IUPACName = (7α,7′α,8α,8′α)-3,4:3′,4′-Bis[methylenebis(oxy)]-7,9′:7′,9-diepoxylignane | SystematicName = 5,5′-[(1S,3aR,4S,6aR)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis(2H-1,3-benzodioxole) | OtherNames = Fagarol Sezamin Pseudocubebin Episesamin Asarinin Eleutheroside B4 D-(+)-Sesamin d-Sesamin (+)-Sesamin l-Sesamin |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 607-80-7 | UNII_Ref = | UNII = S7946O4P76 | PubChem = 5204 | KEGG_Ref = | KEGG = C10882 | ChEBI_Ref = | ChEBI = 66470 | ChEMBL_Ref = | ChEMBL = 252915 | ChemSpiderID_Ref = | ChemSpiderID = 65258 | SMILES = c1cc2c(cc1[C@@H]3[C@H]4COC@@Hc5ccc6c(c5)OCO6)OCO2 | InChI = 1/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19+,20+/m0/s1 | InChIKey = PEYUIKBAABKQKQ-AFHBHXEDBX | StdInChI_Ref = | StdInChI = 1S/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19+,20+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = PEYUIKBAABKQKQ-AFHBHXEDSA-N |Section2={{Chembox Properties | Formula = C20H18O6 | MolarMass = 354.35 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}

Sesamin is a lignan isolated from the bark of Fagara plants and from sesame oil. It has been used as a dietary fat-reduction supplement. Its major metabolite is enterolactone, which has an elimination half life of less than 6 hours. Sesamin and sesamolin are minor components of sesame oil, on average comprising 14% of the oil by mass.

References

References

  1. (May 2005). "Dietary sesamin is converted to enterolactone in humans". J. Nutr..
  2. (Jan 2007). "Comparative analysis of sesame lignans (sesamin and sesamolin) in affecting hepatic fatty acid metabolism in rats.". Br J Nutr.
  3. Ikan, Raphael. (1991). "Natural Products: A Laboratory Guide 2nd Ed.". Academic Press, Inc..

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

cyp3a4-inhibitorsphenol-antioxidantslignansbenzodioxolessesamecyp2c9-inhibitors