Sclareolide

Quality 0.50 · 0 views · Updated 2 months ago

title: "Sclareolide" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["sesquiterpene-lactones", "heterocyclic-compounds-with-3-rings"] topic_path: "general/sesquiterpene-lactones" source: "https://en.wikipedia.org/wiki/Sclareolide" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 455114494 | Name = Sclareolide | ImageFile = Sclareolide.svg | ImageSize = 200px | ImageName = Sclareolide | IUPACName = 3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydronaphtho[8,7-d]furan-2-one | OtherNames = Norambreinolide | Section1 = {{Chembox Identifiers | CASNo_Ref = | CASNo = 564-20-5 | EINECS = 209-269-0 | PubChem = 929262 | ChemSpiderID_Ref = | ChemSpiderID = 809894 | SMILES = C[C@]12CCCC([C@@H]1CC[C@@]3([C@@H]2CC(=O)O3)C)(C)C | InChI = 1/C16H26O2/c1-14(2)7-5-8-15(3)11(14)6-9-16(4)12(15)10-13(17)18-16/h11-12H,5-10H2,1-4H3/t11-,12+,15-,16+/m0/s1 | InChIKey = IMKJGXCIJJXALX-SHUKQUCYBO | StdInChI_Ref = | StdInChI = 1S/C16H26O2/c1-14(2)7-5-8-15(3)11(14)6-9-16(4)12(15)10-13(17)18-16/h11-12H,5-10H2,1-4H3/t11-,12+,15-,16+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = IMKJGXCIJJXALX-SHUKQUCYSA-N | UNII_Ref = | UNII = 37W4O0O6E6 | Section2 = {{Chembox Properties | C=16|H=26|O=2 | Density = 0.55–0.65 g/cm3 | MeltingPtC = 123

Sclareolide is a sesquiterpene lactone natural product derived from various plant sources including Salvia sclarea, Salvia yosgadensis, and cigar tobacco. It is a close analog of sclareol, a plant antifungal compound.

It is used as a fragrance in cosmetics and has been more recently marketed as a weight loss supplement, though there is no clinical evidence to support this effect.

References

References

  1. (1996). "Norditerpenes and Norsesterterpenes from Salvia yosgadensis". [[Journal of Natural Products]].
  2. Kaneko, Hajime. (1971). "Aroma of cigar tobacco. II. Isolation of norambreinolide from cigar tobacco". Agricultural and Biological Chemistry.
  3. (2001). "A Plant Plasma Membrane ATP Binding Cassette–Type Transporter Is Involved in Antifungal Terpenoid Secretion". Plant Cell.
  4. (2022). "RIFM fragrance ingredient safety assessment, sclareolide, CAS Registry Number 564-20-5". Food and Chemical Toxicology.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

sesquiterpene-lactonesheterocyclic-compounds-with-3-rings