S-15535

Chemical compound


title: "S-15535" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["2-aminoindanes", "5-ht1a-agonists", "antiaggressive-drugs", "eltoprazines"] description: "Chemical compound" topic_path: "general/2-aminoindanes" source: "https://en.wikipedia.org/wiki/S-15535" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | verifiedrevid = 405474334 | IUPAC_name = 1-(2,3-dihydro-1,4-benzodioxin-8-yl)-4-(2,3-dihydro-1H-inden-2-yl)piperazine | image = S-15535.svg | image_class = skin-invert-image | tradename = | pregnancy_category = | legal_status = | routes_of_administration = | bioavailability = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 146998-34-7 | UNII_Ref = | UNII = XE6KA72FCB | ATC_prefix = none | ATC_suffix = | PubChem = 132787 | IUPHAR_ligand = 26 | ChEMBL_Ref = | ChEMBL = 49247 | ChemSpiderID_Ref = | ChemSpiderID = 117196 | C=21 | H=24 | N=2 | O=2 | smiles = C1CN(CCN1C2CC3=CC=CC=C3C2)C4=C5C(=CC=C4)OCCO5 | StdInChI_Ref = | StdInChI = 1S/C21H24N2O2/c1-2-5-17-15-18(14-16(17)4-1)22-8-10-23(11-9-22)19-6-3-7-20-21(19)25-13-12-24-20/h1-7,18H,8-15H2 | StdInChIKey_Ref = | StdInChIKey = QJPPEMXOOWNICQ-UHFFFAOYSA-N

S-15535 is a phenylpiperazine drug which is a potent and highly selective 5-HT1A receptor ligand that acts as an agonist and antagonist (weak partial agonist) at the presynaptic and postsynaptic 5-HT1A receptors, respectively. It has anxiolytic and antiaggressive effects.

References

References

  1. (1993). "S 15535: a highly selective benzodioxopiperazine 5-HT1A receptor ligand which acts as an agonist and an antagonist (weak partial agonist) at presynaptic and postsynaptic sites respectively". Eur J Pharmacol.
  2. (1994). "Novel benzodioxopiperazines acting as antagonists at postsynaptic 5-HT1A receptors and as agonists at 5-HT1A autoreceptors: a comparative pharmacological characterization with proposed 5-HT1A antagonists". J Pharmacol Exp Ther.
  3. (1997). "S 15535, a novel benzodioxopiperazine ligand of serotonin (5-HT)1A receptors: I. Interaction with cloned human (h)5-HT1A, dopamine hD2/hD3 and h alpha2A-adrenergic receptors in relation to modulation of cortical monoamine release and activity in models of potential antidepressant activity". J Pharmacol Exp Ther.
  4. (1998). "Induction of burst firing in ventral tegmental area dopaminergic neurons by activation of serotonin (5-HT)1A receptors: WAY 100,635-reversible actions of the highly selective ligands, flesinoxan and S 15535". Synapse.
  5. (2000). "The selective serotonin (5-HT)1A receptor ligand, S15535, displays anxiolytic-like effects in the social interaction and Vogel models and suppresses dialysate levels of 5-HT in the dorsal hippocampus of freely-moving rats. A comparison with other anxiolytic agents". Psychopharmacology.
  6. (December 2005). "5-HT1A and 5-HT1B receptor agonists and aggression: a pharmacological challenge of the serotonin deficiency hypothesis". Eur J Pharmacol.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

2-aminoindanes5-ht1a-agonistsantiaggressive-drugseltoprazines