Ryanodine


title: "Ryanodine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["insecticides", "pyrroles", "carboxylate-esters", "alcohols", "cyclopentanes", "diterpene-alkaloids", "isopropyl-compounds", "plant-toxins"] topic_path: "general/insecticides" source: "https://en.wikipedia.org/wiki/Ryanodine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 464384841 | ImageFile = Ryanodine.svg | ImageSize = 240px | PIN = (1S,2R,2aS,2a1R,3S,3aS,6S,7R,7aR,9S,9aS)-1,2a,2a1,3a,7,9-Hexahydroxy-3,6,9a-trimethyl-1-(propan-2-yl)dodecahydro-3,9-methanobenzo[1,2]pentaleno[1,6-bc]furan-2-yl 1H-pyrrole-2-carboxylate | OtherNames = |Section1={{Chembox Identifiers | IUPHAR_ligand = 4303 | ChemSpiderID_Ref = | ChemSpiderID = 16736002 | InChI = 1/C25H35NO9/c1-12(2)22(31)17(34-16(28)14-7-6-10-26-14)23(32)18(4)11-21(30)19(22,5)25(23,33)24(35-21)15(27)13(3)8-9-20(18,24)29/h6-7,10,12-13,15,17,26-27,29-33H,8-9,11H2,1-5H3/t13-,15+,17+,18-,19+,20-,21-,22+,23+,24+,25+/m0/s1 | InChIKey = JJSYXNQGLHBRRK-SFEDZAPPBA | StdInChI_Ref = | StdInChI = 1S/C25H35NO9/c1-12(2)22(31)17(34-16(28)14-7-6-10-26-14)23(32)18(4)11-21(30)19(22,5)25(23,33)24(35-21)15(27)13(3)8-9-20(18,24)29/h6-7,10,12-13,15,17,26-27,29-33H,8-9,11H2,1-5H3/t13-,15+,17+,18-,19+,20-,21-,22+,23+,24+,25+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = JJSYXNQGLHBRRK-SFEDZAPPSA-N | CASNo_Ref = | CASNo = 15662-33-6 | UNII_Ref = | UNII = 37H6ATE4SA | PubChem = 5114 | ChEMBL_Ref = | ChEMBL = 612231 | ChEBI_Ref = | ChEBI = 8925 | SMILES = C[C@H]1CC[C@@]2([C@@]3(C[C@]4([C@@]5(C@(C(C)C)O)C)O)C)O | MeSHName = Ryanodine | KEGG_Ref = | KEGG = C08705 |Section2={{Chembox Properties | C=25 | H=35 | N=1 | O=9 | Appearance = | Density = | MeltingPt = | BoilingPt = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

Ryanodine is a poisonous diterpenoid found in the South American plant Ryania speciosa (Salicaceae). It was originally used as an insecticide.

The compound has extremely high affinity to the open-form ryanodine receptor, a group of calcium channels found in skeletal muscle, smooth muscle, and heart muscle cells. It binds with such high affinity to the receptor that it was used as a label for the first purification of that class of ion channels and gave its name to it.

At nanomolar concentrations, ryanodine locks the receptor in a half-open state, whereas it fully closes them at micromolar concentration. The effect of the nanomolar-level binding is that ryanodine causes release of calcium from calcium stores as the sarcoplasmic reticulum in the cytoplasm, leading to massive muscle contractions. The effect of micromolar-level binding is paralysis. This is true for both mammals and insects.

References

References

  1. (2015). "Essential Roles of Intracellular Calcium Release Channels in Muscle, Brain, Metabolism, and Aging". Current Molecular Pharmacology.
  2. (2012). "Ryanodine receptors: structure and function". The Journal of Biological Chemistry.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

insecticidespyrrolescarboxylate-estersalcoholscyclopentanesditerpene-alkaloidsisopropyl-compoundsplant-toxins