Rufigallol


title: "Rufigallol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["pyrogallols", "hydroxyanthraquinones", "3-hydroxypropenals"] topic_path: "general/pyrogallols" source: "https://en.wikipedia.org/wiki/Rufigallol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 424853299 | ImageFile = Rufigallol.png | ImageSize = 200px | ImageName = Skeletal formula of rufigallol | ImageFile1 = Rufigallol-3D-balls.png | ImageSize1 = 210px | ImageName1 = Ball-and-stick model of rufigallol | PIN = 1,2,3,5,6,7-Hexahydroxyanthracene-9,10-dione | OtherNames = Rufigallic acid; 1,2,3,5,6,7-Hexahydroxy-9,10-anthraquinone; 1,2,3,5,6,7-Hexahydroxyanthracene-9,10-dione |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo= 82-12-2 | UNII_Ref = | UNII = S977046N6I | PubChem=65737 | SMILES=C1=C2C(=C(C(=C1O)O)O)C(=O)C3=CC(=C(C(=C3C2=O)O)O)O | ChemSpiderID_Ref = | ChemSpiderID = 59160 | InChI = 1/C14H8O8/c15-5-1-3-7(13(21)11(5)19)10(18)4-2-6(16)12(20)14(22)8(4)9(3)17/h1-2,15-16,19-22H | InChIKey = NEIMTOOWBACOHT-UHFFFAOYAS | StdInChI_Ref = | StdInChI = 1S/C14H8O8/c15-5-1-3-7(13(21)11(5)19)10(18)4-2-6(16)12(20)14(22)8(4)9(3)17/h1-2,15-16,19-22H | StdInChIKey_Ref = | StdInChIKey = NEIMTOOWBACOHT-UHFFFAOYSA-N | RTECS = | MeSHName = | ChEBI_Ref = | ChEBI = 37500 |Section2={{Chembox Properties | C=14 | H=8 | O=8 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt =

Rufigallol or 1,2,3,5,6,7-hexahydroxy-9,10-anthraquinone is an organic compound with formula . It one of several hydroxyanthraquinones. It occurs naturally being derived from gallic acid.

The compound is soluble in dioxane, from which it crystallizes as red needles that sublime without melting at 365 °C.

Rufigallol is particularly toxic to the malarial parasite Plasmodium falciparum and has a synergistic effect in combination with the antimalarial drug exifone, which has structural similarities to rufigallol.

Rufigallol forms a crimson-colored complex with beryllium, aluminium, thorium, zirconium and hafnium, and this reaction has been used for the spot and spectrophotometric determination of beryllium in low concentrations.

References

References

  1. (2007). "Microwave-assisted synthesis of rufigallol and its novel room-temperature liquid crystalline derivatives". Tetrahedron Letters.
  2. (1996). "Potentiation of the antimalarial agent rufigallol". Antimicrobial Agents and Chemotherapy.
  3. (1969). "Spectrophotometric determination of beryllium". Mikrochimica Acta.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

pyrogallolshydroxyanthraquinones3-hydroxypropenals