RTI-32
Chemical compound
title: "RTI-32" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["tropanes", "rti-compounds", "dopamine-reuptake-inhibitors", "sympathomimetic-amines", "medical-imaging", "neuroimaging", "methyl-esters", "4-tolyl-compounds"] description: "Chemical compound" topic_path: "general/tropanes" source: "https://en.wikipedia.org/wiki/RTI-32" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| verifiedrevid = 401640840 | IUPAC_name = Methyl (1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate | image = Phenyltropane 11f.svg | image_class = skin-invert-image
| tradename =
| CAS_number = 130342-81-3 | ATC_prefix = | ATC_suffix = | PubChem = 125416 | ChemSpiderID = 111596 | ChEMBL = 1947089
| C=17 | H=23 | N=1 | O=2 | smiles = CC1=CC=C(C=C1)[C@H]2C[C@@H]3CCC@HN3C | StdInChI = 1S/C17H23NO2/c1-11-4-6-12(7-5-11)14-10-13-8-9-15(18(13)2)16(14)17(19)20-3/h4-7,13-16H,8-10H2,1-3H3/t13-,14+,15+,16-/m0/s1 | StdInChIKey = MMKZDDDDODERSJ-JJXSEGSLSA-N
(–)-2β-Carbomethoxy-3β-(4-tolyl)tropane (RTI-4229-32, tolpane) is a phenyltropane-based cocaine analogue that has similar properties in vitro to related drugs such as RTI-31.
::data[format=table]
| 3'4'-xylyl | 0.43 | unknown | 44 | unknown | 2.42 | unknown |
|---|---|---|---|---|---|---|
| :: |
References
References
- (June 2005). "Depression in Parkinson's disease: loss of dopamine and noradrenaline innervation in the limbic system". Brain.
- (March 2002). "Synthesis and biological evaluation of 2-substituted 3beta-tolyltropane derivatives at dopamine, serotonin, and norepinephrine transporters". Journal of Medicinal Chemistry.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::