Rociverine

---

title: "Rociverine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["tertiary-alcohols", "diethylamino-compounds", "carboxylate-esters", "muscarinic-antagonists", "cyclohexanes"] description: "Chemical compound" topic_path: "general/tertiary-alcohols" source: "https://en.wikipedia.org/wiki/Rociverine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

::data[format=table title="Infobox drug"]

Field	Value
type
image	Rociverine.svg
image_class	skin-invert-image
ATC_prefix	A03
ATC_suffix	AA06
CAS_number	53716-44-2
PubChem	24892842
DrugBank	DB13581
ChemSpiderID	28534065
UNII	VI08KS44V0
KEGG	D07078
ChEBI	135440
ChEMBL	4755537
IUPAC_name	1-(diethylamino)propan-2-yl (1S,2S)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate
C	20
SMILES	CCN(CC)CC(C)OC(=O)[C@H]1CCCC[C@@]1(C2CCCCC2)O
StdInChI	InChI=1S/C20H37NO3/c1-4-21(5-2)15-16(3)24-19(22)18-13-9-10-14-20(18,23)17-11-7-6-8-12-17/h16-18,23H,4-15H2,1-3H3/t16?,18-,20+/m1/s1
StdInChIKey	XPYLKZZOBVLVHB-QDKIRNHSSA-N
::

| drug_name = | INN = | type = | image = Rociverine.svg | image_class = skin-invert-image | width = | alt = | caption = | image2 = | width2 = | alt2 = | caption2 = | imageL = | widthL = | altL = | imageR = | widthR = | altR = | captionLR =

| pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_AU_comment = | pregnancy_category= | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATCvet = | ATC_prefix = A03 | ATC_suffix = AA06 | ATC_supplemental =

| legal_AU = | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = | legal_CA_comment = | legal_DE = | legal_DE_comment = | legal_NZ = | legal_NZ_comment = | legal_UK = | legal_UK_comment = | legal_US = | legal_US_comment = | legal_EU = | legal_EU_comment = | legal_UN = | legal_UN_comment = | legal_status =

| bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action= | excretion =

| CAS_number = 53716-44-2 | CAS_supplemental = | PubChem = 24892842 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = DB13581 | ChemSpiderID = 28534065 | UNII = VI08KS44V0 | KEGG = D07078 | ChEBI = 135440 | ChEMBL = 4755537 | NIAID_ChemDB = | PDB_ligand = | synonyms =

| IUPAC_name = 1-(diethylamino)propan-2-yl (1S,2S)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate | C=20 | H=37 | N=1 | O=3 | molecular_weight = | SMILES = CCN(CC)CC(C)OC(=O)[C@H]1CCCC[C@@]1(C2CCCCC2)O | Jmol = | StdInChI = InChI=1S/C20H37NO3/c1-4-21(5-2)15-16(3)24-19(22)18-13-9-10-14-20(18,23)17-11-7-6-8-12-17/h16-18,23H,4-15H2,1-3H3/t16?,18-,20+/m1/s1 | StdInChI_comment = | StdInChIKey = XPYLKZZOBVLVHB-QDKIRNHSSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation =

Rociverine is an antispasmodic drug used to treat urinary, gastrointestinal and biliary spasms. It is antimuscarinic drug.

Medical uses

In India, rociverine is used as part of the "Programmed Labour Protocol" to help reduce pain and shorten the duration of labor. However, an analysis of clinical trials provides little evidence supporting its effectiveness in reducing labor duration.

Pharmacology

The (1R,2R) stereoisomer showed 240-fold greater affinity for the muscarinic receptor, but the (1S,2S) compound showed the best selectivity.

References

References

1. "Rociverine".
2. (1978). "Rociverine, a new antispasmodic agent with balanced neurotropic and myotropic activity". Arzneimittel-Forschung.
3. (June 2013). "Antispasmodics for labour". The Cochrane Database of Systematic Reviews.
4. (July 1995). "Stereoselective inhibition of muscarinic receptor subtypes by the eight stereoisomers related to rociverine". European Journal of Pharmacology.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::