Ro-318220


title: "Ro-318220" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["protein-kinase-inhibitors", "bisindolylmaleimides", "imidothiocarbamates"] topic_path: "general/protein-kinase-inhibitors" source: "https://en.wikipedia.org/wiki/Ro-318220" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| ImageFile = Ro-318220.svg | ImageSize = | ImageAlt = | PIN = 3-{3-[4-(1-Methyl-1H-indol-3-yl)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]-1H-indol-1-yl}propyl carbamimidothioate | OtherNames = |Section1={{Chembox Identifiers | CASNo = 125314-64-9 | CASNo_Ref = | UNII_Ref = | PubChem = 5083 | ChemSpiderID = 4905 | ChEMBL = 6291 | ChEBI = 38912 | UNII = W9A0B5E78O | SMILES = Cn1cc(C2=C(C(=O)NC2=O)c3cn(CCCSC(=N)N)c4ccccc34)c5ccccc15 | InChI = 1/C25H23N5O2S/c1-29-13-17(15-7-2-4-9-19(15)29)21-22(24(32)28-23(21)31)18-14-30(11-6-12-33-25(26)27)20-10-5-3-8-16(18)20/h2-5,7-10,13-14H,6,11-12H2,1H3,(H3,26,27)(H,28,31,32) | InChIKey = DSXXEELGXBCYNQ-UHFFFAOYAO | StdInChI = 1S/C25H23N5O2S/c1-29-13-17(15-7-2-4-9-19(15)29)21-22(24(32)28-23(21)31)18-14-30(11-6-12-33-25(26)27)20-10-5-3-8-16(18)20/h2-5,7-10,13-14H,6,11-12H2,1H3,(H3,26,27)(H,28,31,32) | StdInChIKey = DSXXEELGXBCYNQ-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=25 | H=23 | N=5 | O=2 | S=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}

Ro-318220 is a protein kinase C (PKC) inhibitor of the bisindolylmaleimide class.{{Cite journal | pmid = 8900190 | doi = 10.1074/jbc.271.43.27018 | volume = 271 | issue = 43 | pages = 27018–27024 | last = Beltman | first = Jerlyn |author2=Frank McCormick |author3=Simon J. Cook | title = The Selective Protein Kinase C Inhibitor, Ro-31-8220, Inhibits Mitogen-activated Protein Kinase Phosphatase-1 (MKP-1) Expression, Induces c-Jun Expression, and Activates Jun N-terminal Kinase | journal = Journal of Biological Chemistry | year=1996 | doi-access = free

References

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

protein-kinase-inhibitorsbisindolylmaleimidesimidothiocarbamates