Ranunculin

title: "Ranunculin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["glucosides", "furanones", "ranunculaceae"] topic_path: "general/glucosides" source: "https://en.wikipedia.org/wiki/Ranunculin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| verifiedrevid = 399427368 | ImageFile = Ranunculin skeletal.svg | IUPACName = (5S)-5-[(β-D-Glucopyranosyloxy)methyl]furan-2(5H)-one | SystematicName = (5S)-5-({[(2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)furan-2(5H)-one | OtherNames = |Section1={{Chembox Identifiers | CASNo = 644-69-9 | CASNo_Ref = | UNII_Ref = | UNII = IBP7446K1O | PubChem = 441581 | ChemSpiderID_Ref = | ChemSpiderID = 390250 | StdInChI_Ref = | StdInChI = 1S/C11H16O8/c12-3-6-8(14)9(15)10(16)11(19-6)17-4-5-1-2-7(13)18-5/h1-2,5-6,8-12,14-16H,3-4H2/t5-,6+,8+,9-,10+,11+/m0/s1 | SMILES = C1=CC(=O)OC1COC2C(C(C(C(O2)CO)O)O)O | InChI = 1/C11H16O8/c12-3-6-8(14)9(15)10(16)11(19-6)17-4-5-1-2-7(13)18-5/h1-2,5-6,8-12,14-16H,3-4H2/t5-,6+,8+,9-,10+,11+/m0/s1 | InChIKey = TYWXNGXVSZRXNA-NVZSGMJQBP | StdInChIKey_Ref = | StdInChIKey = TYWXNGXVSZRXNA-NVZSGMJQSA-N |Section2={{Chembox Properties | C=11 | H=16 | O=8 | Appearance = | Density = | MeltingPtC = 141 to 142 | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | FlashPt = | AutoignitionPt = }}
Ranunculin is a glycoside found in many members of the buttercup family, including species of Helleborus, Anemone, Clematis and most commonly Ranunculus. Glycosides are common in plants, where they serve as defense mechanisms against herbivores and microorganisms. When plant cell wall structures are damaged, glycosidase enzymes hydrolyze the inactive glycoside into its components- a sugar and practically any other molecule, which is called the aglycone. Ranunculin is a glucoside, which indicates that glucose is the specific sugar attached its aglycone protoanemonin.
Toxicity
Ranunculin is very stable in acidic medium and fresh plant tissues, but in alkaline solution or damaged plant cells is hydrolyzed into the unstable toxin protoanemonin and glucose.
Protoanemonin release
::data[format=table] | [[File:Protoanemonina.svg|150px]] | protoanemonin | |---|---| ::
References
References
- (August 15, 1996). "Extraction and HPLC Determination of Ranunculin in Species of the Buttercup Family". Journal of Agricultural and Food Chemistr.
- (1998). "Hunnius Pharmazeutisches Wörterbuch". Walter de Gruyter Verlag.
- (July 1, 1965). "The Structure of Anemonin". Journal of the American Chemical Society.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::