Raltitrexed

Chemical compound
title: "Raltitrexed" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["thiophenes", "mammalian-dihydrofolate-reductase-inhibitors", "antifolates", "drugs-developed-by-astrazeneca", "quinazolinones", "lactams", "thymidylate-synthase-inhibitors"] description: "Chemical compound" topic_path: "general/thiophenes" source: "https://en.wikipedia.org/wiki/Raltitrexed" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| verifiedrevid = 464379925 | IUPAC_name = N-[(5-{methyl[(2-methyl-4-oxo-1,4-dihydroquinazolin-6-yl)methyl]amino}-2-thienyl)carbonyl]-L-glutamic acid | image = Raltitrexed.svg | image_class = skin-invert-image | image2 = Raltitrexed ball-and-stick.png | image_class2 = bg-transparent | tradename = | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_UK = POM | legal_US = Not available | legal_status = | routes_of_administration = Intravenous | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | IUPHAR_ligand = 7403 | CAS_number_Ref = | CAS_number = 112887-68-0 | ATC_prefix = L01 | ATC_suffix = BA03 | ATC_supplemental = | PubChem = 104758 | DrugBank_Ref = | DrugBank = DB00293 | ChemSpiderID_Ref = | ChemSpiderID = 94568 | UNII_Ref = | UNII = FCB9EGG971 | KEGG_Ref = | KEGG = D01064 | ChEMBL_Ref = | ChEMBL = 225071 | PDB_ligand = D16 | C=21 | H=22 | N=4 | O=6 | S=1 | smiles = O=C(c3sc(N(C)Cc2cc1C(=O)\N=C(/Nc1cc2)C)cc3)NC@HCCC(=O)O | StdInChI_Ref = | StdInChI = 1S/C21H22N4O6S/c1-11-22-14-4-3-12(9-13(14)19(28)23-11)10-25(2)17-7-6-16(32-17)20(29)24-15(21(30)31)5-8-18(26)27/h3-4,6-7,9,15H,5,8,10H2,1-2H3,(H,24,29)(H,26,27)(H,30,31)(H,22,23,28)/t15-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = IVTVGDXNLFLDRM-HNNXBMFYSA-N
Raltitrexed (Thaltitrexed, Tomudex, TDX, ZD 1694) is an antimetabolite drug used in cancer chemotherapy. It is an inhibitor of thymidylate synthase, and is manufactured by AstraZeneca.
Uses
Used in treatment of colorectal cancer since 1998, it may also be used in the treatment of malignant mesothelioma. Raltitrexed is approved for use in Canada and some European countries, but is not approved by the US FDA.
Mechanism of action
Raltitrexed is chemically similar to folic acid and is in the class of chemotherapy drugs called folate antimetabolites, which inhibit one or more of three enzymes that use folate and derivatives as substrates: DHFR, GARFT and thymidylate synthase. Raltitrexed is fully active after polyglutamylation, which allows cellular retention of the drug.
By inhibiting Thymidylate synthase (TS), thus formation of precursor pyrimidine nucleotides, raltitrexed prevents the formation of DNA and RNA, which are required for the growth and survival of both normal cells and cancer cells.
Inhibition of L1210 cell growth in culture IC50 = 9 nM, is one of the strongest antimetabolites in use.
Structure and phase I clinical trial of the precursor drug, CB3717, was described in 1986.
References
References
- (1999). "The plasma pharmacokinetics and cerebrospinal fluid penetration of the thymidylate synthase inhibitor raltitrexed (Tomudex) in a nonhuman primate model". Cancer Chemother. Pharmacol..
- (1976). "[Primary amebic meningoencephalitis]". Ned Tijdschr Geneeskd.
- "Pharmacogenetics in Colorectal Cancer".
- (January 27, 2009). "EUROPEAN MEDICINES AGENCY DECISION on the granting of a product-specific waiver for raltitrexed (Tomudex)". European Medicines Agency.
- (August 1986). "A phase I evaluation of the quinazoline antifolate thymidylate synthase inhibitor, N10-propargyl-5,8-dideazafolic acid, CB3717". J. Clin. Oncol..
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::