Quebecol

Quality 0.50 · 1 view · Updated 2 months ago

title: "Quebecol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["polyphenols"] topic_path: "general/polyphenols" source: "https://en.wikipedia.org/wiki/Quebecol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448799106 | ImageFile = Quebecol.svg | ImageSize = 180px | ImageAlt = | IUPACName = 2,3,3-Tri-(3-methoxy-4-hydroxyphenyl)-1-propanol | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 1360605-46-4 | UNII_Ref = | UNII = XE6U6NUC3D | PubChem = 56838437 | ChEMBL = 2426727 | ChemSpiderID_Ref = | ChemSpiderID = 29784847 | SMILES = COC1=C(C=CC(=C1)C(CO)C(C2=CC(=C(C=C2)O)OC)C3=CC(=C(C=C3)O)OC)O | InChI = 1/C24H26O7/c1-29-21-10-14(4-7-18(21)26)17(13-25)24(15-5-8-19(27)22(11-15)30-2)16-6-9-20(28)23(12-16)31-3/h4-12,17,24-28H,13H2,1-3H3 | InChIKey = YYZUHPNBYRRBOR-UHFFFAOYAE | StdInChI_Ref = | StdInChI = 1S/C24H26O7/c1-29-21-10-14(4-7-18(21)26)17(13-25)24(15-5-8-19(27)22(11-15)30-2)16-6-9-20(28)23(12-16)31-3/h4-12,17,24-28H,13H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = YYZUHPNBYRRBOR-UHFFFAOYSA-N}} |Section2={{Chembox Properties | C=24 | H=26 | O=7 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}

Quebecol is a polyphenolic chemical compound that has been isolated from maple syrup. It has the chemical formula C24H26O7 and the systematic name 2,3,3-tri-(3-methoxy-4-hydroxyphenyl)-1-propanol. Analysis of maple sap before it is converted into syrup suggests that this compound is not naturally present in the sap but, instead, is formed during extraction or processing. A total synthesis of the compound was reported in 2013.

The chemical compound is named after the Canadian province of Quebec which is the world’s largest producer of maple syrup.

References

References

  1. (2011). "Quebecol, a novel phenolic compound isolated from Canadian maple syrup". Journal of Functional Foods.
  2. Johnson, Tim. (4 April 2011). "Quebecol: A fancy name for healthful compound found in Canadian syrup". Burlington Free Press.
  3. (2013). "Total synthesis of quebecol". Tetrahedron Letters.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

polyphenols