Punicalin
title: "Punicalin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["pomegranate-ellagitannins", "carbonic-anhydrase-inhibitors"] topic_path: "general/pomegranate-ellagitannins" source: "https://en.wikipedia.org/wiki/Punicalin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| verifiedrevid = | Name = Punicalin | ImageFile = Punicalin.svg | ImageName = Chemical structure of punicalin | IUPACName = | OtherNames = 4,6-(S,S)-Gallagyl-D-glucose |Section1={{Chembox Identifiers | CASNo = 65995-64-4 | CASNo_Ref = http://www.chemicalbook.com/ChemicalProductProperty_EN_CB71379252.htm | CASNoOther = | PubChem = 5388496 | ChemSpiderID = 28428695 | SMILES = c1c2c(c(c(c1O)O)O)-c3c4c5c6c(c(c(c(c6oc4=O)O)O)-c7c(cc(c(c7O)O)O)C(=O)O[C@@H]8C@@HOC(C@@HO)O)c(=O)oc5c(c3O)O | InChI = 1/C34H22O22/c35-6-1-4-9(19(39)17(6)37)11-15-13-14-16(33(50)56-28(13)23(43)21(11)41)12(22(42)24(44)29(14)55-32(15)49)10-5(2-7(36)18(38)20(10)40)31(48)54-27-8(3-52-30(4)47)53-34(51)26(46)25(27)45/h1-2,8,25-27,34-46,51H,3H2/t8-,25-,26-,27-,34?/m1/s1 | InChIKey = IQHIEHIKNWLKFB-OBOTWMKHBV | StdInChI = 1S/C34H22O22/c35-6-1-4-9(19(39)17(6)37)11-15-13-14-16(33(50)56-28(13)23(43)21(11)41)12(22(42)24(44)29(14)55-32(15)49)10-5(2-7(36)18(38)20(10)40)31(48)54-27-8(3-52-30(4)47)53-34(51)26(46)25(27)45/h1-2,8,25-27,34-46,51H,3H2/t8-,25-,26-,27-,34?/m1/s1 | StdInChIKey = IQHIEHIKNWLKFB-OBOTWMKHSA-N
| MeSHName = |Section2={{Chembox Properties | Formula = C34H22O22 | MolarMass = 782.52 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = Punicalin is an ellagitannin. It can be found in Punica granatum (pomegranate) or in the leaves of Terminalia catappa, a plant used to treat dermatitis and hepatitis.{{Cite journal | last1 = Lin | first1 = C. C. | last2 = Hsu | first2 = Y. F. | last3 = Lin | first3 = T. C. | last4 = Hsu | first4 = F. L. | last5 = Hsu | first5 = H. Y. | title = Antioxidant and hepatoprotective activity of punicalagin and punicalin on carbon tetrachloride-induced liver damage in rats | journal = The Journal of Pharmacy and Pharmacology | volume = 50 | issue = 7 | pages = 789–794 | year = 1998 | pmid = 9720629 | doi=10.1111/j.2042-7158.1998.tb07141.x | s2cid = 8639399 | doi-access = free
It is a highly active carbonic anhydrase inhibitor.{{Cite journal | last1 = Satomi | first1 = H. | last2 = Umemura | first2 = K. | last3 = Ueno | first3 = A. | last4 = Hatano | first4 = T. | last5 = Okuda | first5 = T. | last6 = Noro | first6 = T. | title = Carbonic anhydrase inhibitors from the pericarps of Punica granatum L | journal = Biological & Pharmaceutical Bulletin | volume = 16 | issue = 8 | pages = 787–790 | year = 1993 | pmid = 8220326 | doi=10.1248/bpb.16.787 | doi-access = free
Chemistry
The molecule contains a gallagic acid component linked to a glucose.
References
References
- (2009). "Absence of Pomegranate Ellagitannins in the Majority of Commercial Pomegranate Extracts: Implications for Standardization and Quality Control". Journal of Agricultural and Food Chemistry.
- (1999). "Effects of punicalagin and punicalin on carrageenan-induced inflammation in rats". The American Journal of Chinese Medicine.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::