Pristane


title: "Pristane" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["alkanes", "diterpenes"] topic_path: "general/alkanes" source: "https://en.wikipedia.org/wiki/Pristane" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477172090| ImageFile = Pristane1.svg| ImageFile_Ref = | ImageName = Skeletal formula of pristane| IUPACName = 2,6,10,14-Tetramethylpentadecane |Section1={{Chembox Identifiers | CASNo = 1921-70-6 | CASNo_Ref = | UNII_Ref = | UNII = 26HZV48DT1 | PubChem = 15979 | ChemSpiderID = 15182 | ChemSpiderID_Ref = | ChemSpiderID1 = 24531975 | ChemSpiderID1_Ref = | ChemSpiderID1_Comment = 6R,10R | ChemSpiderID2 = 21428537 | ChemSpiderID2_Ref = | ChemSpiderID2_Comment = 6R,10S | ChemSpiderID3 = 24531981 | ChemSpiderID3_Ref = | ChemSpiderID3_Comment = 6S,10S | EINECS = 217-650-8 | MeSHName = pristane | ChEBI = 53181 | ChEBI_Ref = | RTECS = RZ1880000 | Beilstein = 1720538 | SMILES = CC(C)CCCC(C)CCCC(C)CCCC(C)C | StdInChI = 1S/C19H40/c1-16(2)10-7-12-18(5)14-9-15-19(6)13-8-11-17(3)4/h16-19H,7-15H2,1-6H3 | StdInChI_Ref = | StdInChIKey = XOJVVFBFDXDTEG-UHFFFAOYSA-N | StdInChIKey_Ref = |Section2={{Chembox Properties | C=19 | H=40 | Appearance = Colorless liquid | Odor = Odorless | Density = 783 mg mL−1 | MeltingPtK = 173.2 | BoilingPtC = 296 | RefractIndex = 1.438 |Section3={{Chembox Thermochemistry | HeatCapacity = 569.76 J K−1 mol−1 |Section4={{Chembox Hazards | GHSPictograms = | GHSSignalWord = WARNING | HPhrases = | FlashPt = 110 °C |Section5={{Chembox Related | OtherFunction_label = alkanes | OtherFunction = Pristane is a natural saturated terpenoid alkane obtained primarily from shark liver oil, from which its name is derived (Latin pristis, "shark"). It is also found in the stomach oil of birds in the order Procellariiformes and in mineral oil and some foods. Pristane and phytane are used in the fields of geology and environmental science as biomarkers to characterize origins and evolution of petroleum hydrocarbons and coal.

It is a transparent oily liquid that is immiscible with water, but soluble in diethyl ether, benzene, chloroform and carbon tetrachloride.

Pristane is known to induce autoimmune diseases in rodents. It is used in research to understand the pathogenesis of rheumatoid arthritis and lupus.

It is used as a lubricant, a transformer oil, an immunologic adjuvant, and an anti-corrosion agent, biological marker, plasmocytomas inducer and in production of monoclonal antibodies.

Biosynthetically, pristane is derived from phytol and is used as a biomarker in petroleum studies. Tocopherols represent an alternate sedimentary source of pristane in sediments and petroleum.

Toxicity of pristane is alleviated by aconitine.

References

References

  1. (26 March 2005). "pristane - Compound Summary". National Center for Biotechnology Information.
  2. (1989). "A survey of the amount of pristane in common fruits and vegetables". Journal of Food Composition and Analysis.
  3. (April 1969). "Isoprenoid Hydrocarbons in Coal and Petroleum". Nature.
  4. (1969). "Induction of Plasma Cell Tumours in BALB/c Mice with 2,6,10,14-Tetramethylpentadecane (Pristane)". Nature.
  5. (2008). "Surreptitious Injection of Mineral Oil". Annals of Plastic Surgery.
  6. (2013). "Dubois' Lupus Erythematosus and Related Syndromes".
  7. (2002). "Early developments in petroleum geochemistry". Organic Geochemistry.
  8. (1984). "Tocopherols as likely precursors of pristane in ancient sediments and crude oils". Nature.
  9. (2017). "Aconitine: A potential novel treatment for systemic lupus erythematosus". Journal of Pharmacological Sciences.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

alkanesditerpenes