Pindone
Pindone is an organic compound. A derivative of 1,3-indandione, it is used as a rodenticide. Its mode of action is as a anticoagulant. for agricultural use. It is commonly used as a rodenticide in the management of rat and rabbit populations.
.mw-parser-output .ib-chembox{border-collapse:collapse;text-align:left}.mw-parser-output .ib-chembox td,.mw-parser-output .ib-chembox th{border:1px solid #a2a9b1;width:40%}.mw-parser-output .ib-chembox td+td{width:60%}@media screen{html.skin-theme-clientpref-night .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}@media screen and (prefers-color-scheme:dark){html.skin-theme-clientpref-os .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| 2-(2,2-Dimethylpropanoyl)-1H-indene-1,3(2H)-dione | |
| Other names | |
| 2-Pivaloyl-1,3-indandione | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}83-26-1 Y |
| 3D model (JSmol) | Interactive image |
| ChemSpider | 6476 Y |
| ECHA InfoCard | 100.001.330 |
| KEGG | C19141 N |
| PubChem CID | 6732 |
| UNII | 2KFI1XBH7G Y |
| CompTox Dashboard (EPA) | DTXSID1025930 |
| InChI | |
| InChI=1S/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 YKey: RZKYEQDPDZUERB-UHFFFAOYSA-N YInChI=1/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3Key: RZKYEQDPDZUERB-UHFFFAOYAX | |
| SMILES | |
| O=C2c1ccccc1C(=O)C2C(=O)C(C)(C)C | |
| Chemical formula | C14H14O3 |
| Molar mass | 230.26 g/mol |
| Appearance | Bright-yellow powder |
| Odor | almost none |
| Density | 1.06 g/mL |
| Melting point | 110 °C (230 °F; 383 K) |
| Solubility in water | 0.002% (25°C) |
| Lethal dose or concentration (LD, LC): | |
| LD50 (median dose) | 280 mg/kg (rat, oral)75 mg/kg (dog, oral)150 mg/kg (rabbit, oral) |
| NIOSH (US health exposure limits): | |
| PEL (Permissible) | TWA 0.1 mg/m3 |
| REL (Recommended) | TWA 0.1 mg/m3 |
| IDLH (Immediate danger) | 100 mg/m3 |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| N verify (what is YN ?) |
Infobox references | |
Pindone is an organic compound. A derivative of 1,3-indandione, it is used as a rodenticide. Its mode of action is as a anticoagulant. for agricultural use. It is commonly used as a rodenticide in the management of rat and rabbit populations.
It is pharmacologically analogous to warfarin and inhibits the synthesis of vitamin K-dependent clotting factors.
.mw-parser-output .reflist-columns-2{column-width:30em}.mw-parser-output .reflist-columns-3{column-width:25em}body.skin-vector-2022 .mw-parser-output .reflist-columns-2{column-width:27em}body.skin-vector-2022 .mw-parser-output .reflist-columns-3{column-width:22.5em}.mw-parser-output .references[data-mw-group=upper-alpha]{list-style-type:upper-alpha}.mw-parser-output .references[data-mw-group=upper-roman]{list-style-type:upper-roman}.mw-parser-output .references[data-mw-group=lower-alpha]{list-style-type:lower-alpha}.mw-parser-output .references[data-mw-group=lower-greek]{list-style-type:lower-greek}.mw-parser-output .references[data-mw-group=lower-roman]{list-style-type:lower-roman}.mw-parser-output div.reflist-liststyle-upper-alpha .references{list-style-type:upper-alpha}.mw-parser-output div.reflist-liststyle-upper-roman .references{list-style-type:upper-roman}.mw-parser-output div.reflist-liststyle-lower-alpha .references{list-style-type:lower-alpha}.mw-parser-output div.reflist-liststyle-lower-greek .references{list-style-type:lower-greek}.mw-parser-output div.reflist-liststyle-lower-roman .references{list-style-type:lower-roman}
.mw-parser-output .asbox{position:relative;overflow:hidden}.mw-parser-output .asbox table{background:transparent}.mw-parser-output .asbox p{margin:0}.mw-parser-output .asbox p+p{margin-top:0.25em}.mw-parser-output .asbox-body{font-style:italic}.mw-parser-output .asbox-note{font-size:smaller}.mw-parser-output .asbox .navbar{position:absolute;top:-0.75em;right:1em;display:none}.mw-parser-output :not(p):not(.asbox)+style+.asbox,.mw-parser-output :not(p):not(.asbox)+link+.asbox{margin-top:3em}