Parafluorofentanyl

Opioid analgesic
title: "Parafluorofentanyl" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["synthetic-opioids", "piperidines", "4-fluorophenyl-compounds", "propionamides", "anilides", "mu-opioid-receptor-agonists", "designer-drugs", "fentanyl"] description: "Opioid analgesic" topic_path: "general/synthetic-opioids" source: "https://en.wikipedia.org/wiki/Parafluorofentanyl" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Opioid analgesic ::
| Verifiedfields = changed | verifiedrevid = 451463728 | IUPAC_name = N-(4-fluorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide | image = Parafluorofentanyl.svg | image_class = skin-invert-image | width = 220px | image2 = P-fluorofentanyl.png | image_class2 = bg-transparent | width2 = 220px
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_BR = F1 | legal_CA = Schedule I | legal_UK = Class A | legal_US = Schedule I | legal_DE = Anlage I | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 90736-23-5 | ATC_prefix = none | ATC_suffix = | PubChem = 62300 | KEGG = C22769 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 56096 | ChEBI_Ref = | ChEBI = 61074 | UNII_Ref = | UNII = I45R05QM0Z
| C=22 | H=27 | F=1 | N=2 | O=1 | smiles = Fc1ccc(cc1)N(C(=O)CC)C3CCN(CCc2ccccc2)CC3 | StdInChI_Ref = | StdInChI = 1S/C22H27FN2O/c1-2-22(26)25(20-10-8-19(23)9-11-20)21-13-16-24(17-14-21)15-12-18-6-4-3-5-7-18/h3-11,21H,2,12-17H2,1H3 | StdInChIKey_Ref = | StdInChIKey = KXUBAVLIJFTASZ-UHFFFAOYSA-N | synonyms = 4-Fluorofentanyl; Para-fluorofentanyl; pFF
Parafluorofentanyl (4-fluorofentanyl, pFF) is an opioid analgesic analogue of fentanyl developed by Janssen Pharmaceuticals in the 1960s.
4-Fluorofentanyl was sold briefly on the US black market in the early 1980s, before the introduction of the Federal Analog Act which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared. 4-Fluorofentanyl is made by the same synthetic route as fentanyl, but by substituting para-fluoroaniline for aniline in the synthesis.
Side effects of fentanyl analogs are similar to those of fentanyl itself, which include itching, nausea, and potentially serious respiratory depression, which can be life-threatening. Fentanyl analogs have killed thousands of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear.
In 2020, the Drug Enforcement Agency warned about the increasing prevalence of parafluorofentanyl in Arizona.
References
References
- {{ cite patent
- (March 1988). "Designer drugs: past history and future prospects". Journal of Forensic Sciences.
- (September 2000). "Interaction of p-fluorofentanyl on cloned human opioid receptors and exploration of the role of Trp-318 and His-319 in mu-opioid receptor selectivity". The Journal of Pharmacology and Experimental Therapeutics.
- (July 2015). "Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe". The International Journal on Drug Policy.
- (December 28, 2020). "DEA warns of newly encountered fentanyl-like drug in Arizona".
- (December 29, 2020). "DEA in Arizona warns of 'extremely dangerous' form of fentanyl".
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::