Panuramine
Chemical compound
title: "Panuramine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["benzamides", "2-naphthyl-compounds", "piperidines", "selective-serotonin-reuptake-inhibitors", "ureas"] description: "Chemical compound" topic_path: "general/benzamides" source: "https://en.wikipedia.org/wiki/Panuramine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| IUPAC_name = N-{[1-(naphthalen-2-ylmethyl)piperidin-4-yl]carbamoyl}benzamide | image = Panuramine.svg | image_class = skin-invert-image | width = 225
| tradename = | pregnancy_category = | legal_status = | routes_of_administration =
| bioavailability = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 80349-58-2 | CAS_supplemental = (HCl) | ATC_prefix = None | ATC_suffix = | PubChem = 72002 | ChemSpiderID = 65002 | UNII_Ref = | UNII = 1UWS3T8EAB
| C=24 | H=25 | N=3 | O=2 | smiles = O=C(c1ccccc1)NC(=O)NC4CCN(Cc2ccc3c(c2)cccc3)CC4
Panuramine (Wy-26,002) is an antidepressant which was synthesized in 1981 by Wyeth. It acts as a potent and selective serotonin reuptake inhibitor (SSRI). It was never marketed.
References
References
- David J. Triggle. (1997). "Dictionary of pharmacological agents". Chapman & Hall.
- (September 1984). "Panuramine, a selective inhibitor of uptake of 5-hydroxytryptamine in the brain of the rat". Neuropharmacology.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::