Pafuramidine


title: "Pafuramidine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["furans", "antiparasitic-agents", "amidines"] topic_path: "general/furans" source: "https://en.wikipedia.org/wiki/Pafuramidine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| ImageFile = Pafuramidine.svg | ImageClass = skin-invert-image | ImageAlt = | IUPACName = N′-Methoxy-4-[5-[4-[(Z)-N′-methoxycarbamimidoyl]phenyl]furan-2-yl] benzenecarboximidamide | OtherNames = DB289 |Section1={{Chembox Identifiers | CASNo = 186953-56-0 | CASNo_Ref = | CASNo1 = 837369-26-3 | CASNo1_Ref = | CASNo1_Comment = (maleate) | PubChem = 5480200 | ChEMBL = 319669 | UNII_Ref = | UNII = H1VG379J2X | UNII1_Ref = | UNII1 = K27F04K3A9 | UNII1_Comment = (maleate)

| SMILES = CO/N=C(\N)/C1=CC=C(C=C1)C2=CC=C(O2)C3=CC=C(C=C3)/C(=N/OC)/N | ChemSpiderID = 4586633 | InChI = 1/C20H20N4O3/c1-25-23-19(21)15-7-3-13(4-8-15)17-11-12-18(27-17)14-5-9-16(10-6-14)20(22)24-26-2/h3-12H,1-2H3,(H2,21,23)(H2,22,24) | InChIKey = UKOQVLAXCBRRGH-UHFFFAOYAE | StdInChI = 1S/C20H20N4O3/c1-25-23-19(21)15-7-3-13(4-8-15)17-11-12-18(27-17)14-5-9-16(10-6-14)20(22)24-26-2/h3-12H,1-2H3,(H2,21,23)(H2,22,24) | StdInChIKey = UKOQVLAXCBRRGH-UHFFFAOYSA-N}} |Section2={{Chembox Properties | C=20 | H=20 | N=4 | O=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} |Section5={{Chembox Pharmacology | AdminRoutes = Oral | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = Investigational | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Pregnancy_category = | Pregnancy_AU =

Pafuramidine (formulated as the maleic acid salt pafuramidine maleate) is an experimental drug for the treatment of pneumocystis pneumonia (PCP). In 2006, pafuramidine was given orphan drug status by the US Food and Drug Administration for PCP in patients with HIV/AIDS. Preliminary clinical trials indicated that pafuramide was effective against pneumocystis pneumonia and had the potential for fewer side effects than the standard treatment with trimethoprim/sulfamethoxazole (TMP-SMX).

Pafuramidine also reached Phase III clinical trials for the treatment of first stage African sleeping sickness, but development was halted in 2008 over concerns about kidney toxicity.

References

References

  1. (November 21, 2006). "US FDA Grants Immtech's Oral Drug Candidate Pafuramidine (DB289) Orphan Drug Status for Treatment of PCP". [[Drugs.com]].
  2. (December 2007). "Pafuramidine for Pneumocystis jiroveci pneumonia in HIV-infected individuals". Expert Review of Anti-Infective Therapy.
  3. "Pafuramidine maleate (DB289)". Swiss Tropical and Public Health Initiative.
  4. (December 2012). "A mouse diversity panel approach reveals the potential for clinical kidney injury due to DB289 not predicted by classical rodent models". Toxicological Sciences.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

furansantiparasitic-agentsamidines