Otilonium bromide

Chemical compound


title: "Otilonium bromide" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["muscarinic-antagonists", "quaternary-ammonium-compounds", "phenol-ethers", "benzanilides", "4-aminobenzoate-esters", "bromides"] description: "Chemical compound" topic_path: "general/muscarinic-antagonists" source: "https://en.wikipedia.org/wiki/Otilonium_bromide" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 408354493 | IUPAC_name = N,N-Diethyl-N-methyl-2-(4-[2-(octyloxy)benzamido]benzoyloxy)ethanaminium bromide | image = Otilonium bromide.png | image_class = skin-invert-image

| tradename = Spasmoctyl 40, Doralin, Menoctyl | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | bioavailability = 1.1% | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 26095-59-0 | ATC_prefix = A03 | ATC_suffix = AB06 | PubChem = 72092 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = 21HN3N72PV | KEGG_Ref = | KEGG = D07083 | ChemSpiderID_Ref = | ChemSpiderID = 65077

| C = 29 | H = 43 | Br = 1 | N = 2 | O = 4 | smiles = CCCCCCCCOC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)OCCN+(CC)CC.[Br-] | StdInChI_Ref = | StdInChI = 1S/C29H42N2O4.BrH/c1-5-8-9-10-11-14-22-34-27-16-13-12-15-26(27)28(32)30-25-19-17-24(18-20-25)29(33)35-23-21-31(4,6-2)7-3;/h12-13,15-20H,5-11,14,21-23H2,1-4H3;1H | StdInChIKey_Ref = | StdInChIKey = VWZPIJGXYWHBOW-UHFFFAOYSA-N

Otilonium bromide is a drug used to treat abdominal pain caused by irritable bowel syndrome. It is an antispasmodic, which is useful to treat the symptoms of irritable bowel syndrome by reducing abdominal spasms (colic), bloating, pain, and gut motility.

It is an antimuscarinic and calcium channel blocker used to relieve spasmodic pain of the gut, especially in irritable bowel syndrome. This means it works in the gut themselves, by relaxing the small muscles of the intestines, which results in relieving cramps and therefore reduces pain.

Medical uses

A pooled analysis of three clinical trials suggest that otilonium bromide is more effective than placebo for the treatment of irritable bowel syndrome.

Pharmacology

Otilonium bromide binds to both muscarinic receptors and tachykinin NK2 receptors. It has been shown to inhibit L-type and T-type calcium channels, actions which may contribute to or determine its effects in the gut.

When taken orally, very little of the drug is absorbed into the rest of the body, which means that most of its actions remain confined to the gastrointestinal system.

Adverse effects

Otilonium bromide is generally well tolerated and does not have the side-effects observed with similar classes of drugs. A case of cardiovascular toxicity was reported due to an overdose.

References

References

  1. (January 2008). "Oral bioavailability and enterohepatic recirculation of otilonium bromide in rats". Archives of Pharmacal Research.
  2. "Dismox".
  3. (March 2017). "Efficacy of otilonium bromide in irritable bowel syndrome: a pooled analysis". Therapeutic Advances in Gastroenterology.
  4. (1999). "Otilonium bromide: a selective spasmolytic for the gastrointestinal tract". The Journal of International Medical Research.
  5. (April 2004). "Otilonium bromide inhibits muscle contractions via L-type calcium channels in the rat colon". Neurogastroenterology and Motility.
  6. (May 2010). "T-type Ca(2+) channel modulation by otilonium bromide". American Journal of Physiology. Gastrointestinal and Liver Physiology.
  7. (January 2008). "Oral bioavailability and enterohepatic recirculation of otilonium bromide in rats". Archives of Pharmacal Research.
  8. (November 2004). "Quaternary ammonium derivatives as spasmolytics for irritable bowel syndrome". Current Pharmaceutical Design.
  9. (March 2022). "Cardiovascular Toxicity Due to Otilonium Bromide Overdose: A Case Report". The Journal of Emergency Medicine.
  10. "Submission for the classification of Otilonium bromide 40 mg film-coated tables (10 and 30 tablet pack) as Pharmacist Only". Arai BioFarma Limited.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

muscarinic-antagonistsquaternary-ammonium-compoundsphenol-ethersbenzanilides4-aminobenzoate-estersbromides