Ombrabulin

title: "Ombrabulin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["experimental-cancer-drugs", "amino-acid-derivatives"] topic_path: "general/experimental-cancer-drugs" source: "https://en.wikipedia.org/wiki/Ombrabulin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 445300917 | ImageFile = Ombrabulin.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageAlt = | IUPACName = N1-{2-Methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethen-1-yl]phenyl}-L-serinamide | SystematicName = (2S)-2-Amino-3-hydroxy-N-{2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethen-1-yl]phenyl}propanamide | OtherNames = AVE-8062; AVE-8062A; AC7700; CS-39-L-Ser.HCl |Section1={{Chembox Identifiers | CASNo =181816-48-8 | CASNo_Ref = | CASNo1 =253426-24-3 | CASNo1_Ref = | CASNo1_Comment = (HCl) | UNII_Ref = | UNII = 82JB1524Q6 | UNII1 = KXZ9NDO6H0 | UNII1_Ref = | UNII1_Comment = (HCl) | PubChem =6918405 | PubChem1 = 6918404 | PubChem1_Comment = (HCl) | SMILES = COC1=C(C=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)NC(=O)C@HN | ChemSpiderID_Ref = | ChemSpiderID = 5293602 | InChI = 1/C21H26N2O6/c1-26-17-8-7-13(9-16(17)23-21(25)15(22)12-24)5-6-14-10-18(27-2)20(29-4)19(11-14)28-3/h5-11,15,24H,12,22H2,1-4H3,(H,23,25)/b6-5-/t15-/m0/s1 | InChIKey = IXWNTLSTOZFSCM-YVACAVLKBS | StdInChI_Ref = | StdInChI = 1S/C21H26N2O6/c1-26-17-8-7-13(9-16(17)23-21(25)15(22)12-24)5-6-14-10-18(27-2)20(29-4)19(11-14)28-3/h5-11,15,24H,12,22H2,1-4H3,(H,23,25)/b6-5-/t15-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = IXWNTLSTOZFSCM-YVACAVLKSA-N}} |Section2={{Chembox Properties | C=21 | H=26 | N=2 | O=6 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}
Ombrabulin was an experimental drug candidate discovered by Ajinomoto and further developed by Sanofi-Aventis. Ombrabulin is a combretastatin A-4 derivative that exerts its antitumor effect by disrupting the formation of blood vessels needed for tumor growth.
It was granted orphan drug status by the European Medicines Agency in April 2011.
In January 2013, Sanofi said it discontinued development of ombrabulin after disappointing results from phase III clinical trials.
References
References
- "Ombrabulin (AVE8062)". Sanofi-Aventis Oncology.
- (1999). "Antitumor effects due to irreversible stoppage of tumor tissue blood flow: evaluation of a novel combretastatin A-4 derivative, AC7700". Japanese Journal of Cancer Research.
- (2002). "A novel combretastatin A-4 derivative, AC7700, strongly stanches tumour blood flow and inhibits growth of tumours developing in various tissues and organs". British Journal of Cancer.
- (15 April 2011). "Orphan Designation EU/3/11/853". European Medicines Agency.
- "Sanofi has 65 new compounds in development, says R&D chief".
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::