Oleanolic acid

Pentacyclic chemical compound in plant leaves and fruit


title: "Oleanolic acid" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["triterpenes", "secondary-alcohols", "hydroxycarboxylic-acids"] description: "Pentacyclic chemical compound in plant leaves and fruit" topic_path: "general/triterpenes" source: "https://en.wikipedia.org/wiki/Oleanolic_acid" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Pentacyclic chemical compound in plant leaves and fruit ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 434037539 | Name = Oleanolic acid | Reference = | ImageFile = Oleanolic acid.png | ImageClass = skin-invert-image | ImageName = Oleanolic acid | IUPACName = 3β-Hydroxyolean-12-en-28-oic acid | SystematicName = (4aS,6aS,6bR,8aR,10S,12aR,12bR,14bS)-10-Hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-octadecahydropicene-4a(2H)-carboxylic acid | OtherNames = Oleanic acid |Section1={{Chembox Identifiers | IUPHAR_ligand = 3306 | Abbreviations = | InChI = 1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23-,27-,28+,29+,30-/m0/s1 | InChIKey = MIJYXULNPSFWEK-GTOFXWBIBS | StdInChI_Ref = | StdInChI = 1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23-,27-,28+,29+,30-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = MIJYXULNPSFWEK-GTOFXWBISA-N | InChIKey1 = MIJYXULNPSFWEK-GTOFXWBISA-N | CASNo = 508-02-1 | CASNo_Ref = | CASNoOther = | UNII_Ref = | UNII = 6SMK8R7TGJ | PubChem = 10494 | EINECS = 208-081-6 | EC_number = | UNNumber = | DrugBank_Ref = | DrugBank = | KEGG_Ref = | KEGG = | ChEMBL_Ref = | ChEMBL = 168 | MeSHName = | ChEBI_Ref = | ChEBI = 37659 | RTECS = | SMILES = O=C(O)[C@@]54C@HCC(C)(C)CC5 | Beilstein = | Gmelin = | ChemSpiderID_Ref = | ChemSpiderID = 10062 | 3DMet = |Section2={{Chembox Properties | C=30 | H=48 | O=3 | Appearance = White | Density = | MeltingPt= | MeltingPtC = 300 | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | LogP = | VaporPressure = | HenryConstant = | AtmosphericOHRateConstant = | pKa = | pKb = |Section3={{Chembox Structure | CrystalStruct = | Coordination = | MolShape = |Section4={{Chembox Thermochemistry | DeltaHf = | DeltaHc = | Entropy = | HeatCapacity = |Section5={{Chembox Pharmacology | AdminRoutes = | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_US = |Section6={{Chembox Explosive | ShockSens = | FrictionSens = | DetonationV = | REFactor = |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | LD50 = | PEL = |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds =

Oleanolic acid or oleanic acid is a naturally occurring pentacyclic triterpenoid related to betulinic acid. It is widely distributed in food and plants where it exists as a free acid or as an aglycone of triterpenoid saponins.

Natural occurrence

Oleanolic acid can be found in olive oil, Phytolacca americana (American pokeweed), and Syzygium spp, garlic, etc. It was first studied and isolated from several plants, including Olea europaea (leaves, fruit), Rosa woodsii (leaves), Prosopis glandulosa (leaves and twigs), Phoradendron juniperinum (whole plant), Syzygium claviflorum (leaves), Hyptis capitata (whole plant), Mirabilis jalapa and Ternstroemia gymnanthera (aerial part). Other Syzygium species including java apple (Syzygium samarangense) and rose apples contain it, as does Ocimum tenuiflorum (holy basil).

Biosynthesis of oleanolic acids

Oleanolic acid biosynthesis starts with mevalonate to create squalene. Squalene monooxygenase in the next step oxidases the squalene and forms an epoxide resulting in 2,3-oxidosqualene. Beta-amyrin synthase creates beta-amyrin by a ring formation cascade. After the formation of beta amyrin, CYP716AATR2, also known as a cytochrome p450 enzyme, oxidizes carbon 28 turning it into alcohol. CYP716AATR2 converts the alcohol to aldehyde and finally to a carboxylic acid forming oleanolic acid. ::figure[src="https://upload.wikimedia.org/wikipedia/commons/2/26/Oleanolic_Acid_Biosynthesis.gif" caption="Biosynthesis of Oleanolic Acid in Saccharomyces Cerevisiae"] ::

Pharmacological research

Oleanolic acid is relatively non-toxic, hepatoprotective, and exhibits antitumor and antiviral properties. Oleanolic acid was found to exhibit weak anti-HIV and weak anti-HCV activities in vitro, but more potent synthetic analogs are being investigated as potential drugs.

An extremely potent synthetic triterpenoid analog of oleanolic acid was found in 2005, that is a powerful inhibitor of cellular inflammatory processes. They work by the induction by IFN-γ of inducible nitric oxide synthase (iNOS) and of cyclooxygenase 2 in mouse macrophages. They are extremely potent inducers of the phase 2 response (e.g., elevation of NADH-quinone oxidoreductase and heme oxygenase 1), which is a major protector of cells against oxidative and electrophile stress.

A 2002 study in Wistar rats found that oleanolic acid reduced sperm quality and motility, causing infertility. After withdrawing exposure, male rats regained fertility and successfully impregnated female rats. Oleanolic acid is also used as standard for comparison of hyaluronidase, elastase and matrix-metalloproteinase-1 inhibition of other substances in primary research (similar to diclofenac sodium for comparison of analgesic activity).

Oleanolic acid activates telomerase in peripheral blood mononuclear cells (PBMCs) 5.9-fold, more than any other compounded tested, with the exception of Centella asiatica (8.8-fold). Less telomerase activation is seen for Astragalus extract 4.3-fold, TA-65 2.2-fold, and maslinic acid 2-fold.

References

References

  1. . ["Oleanolic acid"](https://www.sigmaaldrich.com/catalog/product/aldrich/o5504?lang=en®ion=GB). *Merck*.
  2. (May 2012). "Oleanolic acid". Phytochemistry.
  3. . ["Oleanolic acid (HMDB0002364)"](http://www.hmdb.ca/metabolites/HMDB0002364). *Canadian Institutes of Health Research*.
  4. (1990). "Constituents of Mirabilis jalapa". Fitoterapia.
  5. (December 2011). "CYP716A subfamily members are multifunctional oxidases in triterpenoid biosynthesis". Plant & Cell Physiology.
  6. (2020-05-01). "A systematic comparison of triterpenoid biosynthetic enzymes for the production of oleanolic acid in Saccharomyces cerevisiae". PLOS ONE.
  7. (December 1995). "Pharmacology of oleanolic acid and ursolic acid". Journal of Ethnopharmacology.
  8. (February 2002). "In vitro anti-HIV activity of oleanolic acid on infected human mononuclear cells". Planta Medica.
  9. (June 2013). "Development of oleanane-type triterpenes as a new class of HCV entry inhibitors". Journal of Medicinal Chemistry.
  10. (March 2005). "Extremely potent triterpenoid inducers of the phase 2 response: correlations of protection against oxidant and inflammatory stress". Proceedings of the National Academy of Sciences of the United States of America.
  11. (October 2002). "The effect of oleanolic acid on sperm motion characteristics and fertility of male Wistar rats". Laboratory Animals.
  12. (2012). "Standardized Clitoria ternatea leaf extract as hyaluronidase, elastase and matrix-metalloproteinase-1 inhibitor". Indian Journal of Pharmacology.
  13. (September 2013). "Matrix metalloproteinase, hyaluronidase and elastase inhibitory potential of standardized extract of Centella asiatica". Pharmaceutical Biology.
  14. (2019). "Discovery of potent telomerase activators: Unfolding new therapeutic and anti-aging perspectives". Molecular Medicine Reports.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

triterpenessecondary-alcoholshydroxycarboxylic-acids