Naltriben

Quality 0.50 · 1 view · Updated 2 months ago

Chemical compound

title: "Naltriben" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["delta-opioid-receptor-antagonists", "dibenzofurans", "4,5-epoxymorphinans", "hydroxyarenes", "tertiary-alcohols", "kappa-opioid-receptor-agonists", "semisynthetic-opioids", "cyclopropyl-compounds"] description: "Chemical compound" topic_path: "general/delta-opioid-receptor-antagonists" source: "https://en.wikipedia.org/wiki/Naltriben" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| verifiedrevid = 444022443 | IUPAC_name = | image = Naltriben.svg | image_class = skin-invert-image | alt = Skeletal formula | width = 215 | image2 = Naltriben molecule ball.png | image_class2 = bg-transparent | alt2 = Ball-and-stick model of naltriben

| tradename = | routes_of_administration = | metabolism = | excretion = | CAS_number = 111555-58-9 | CAS_number_Ref = | UNII_Ref = | UNII = RXG719F189 | ATC_prefix = none | PubChem = 5486827 | IUPHAR_ligand = 1640 | ChemSpiderID_Ref = | ChemSpiderID = 4589081 | ChEMBL_Ref = | PDB_ligand = ZY8 | ChEMBL = 100940

| C = 26 | H = 25 | N = 1 | O = 4 | smiles = Oc3c2O[C@H]6c1oc8ccccc8c1C[C@@]5(O)[C@H]4N(CC[C@@]56c2c(cc3)C4)CC7CC7 | StdInChI_Ref = | StdInChI = 1S/C26H25NO4/c28-18-8-7-15-11-20-26(29)12-17-16-3-1-2-4-19(16)30-22(17)24-25(26,21(15)23(18)31-24)9-10-27(20)13-14-5-6-14/h1-4,7-8,14,20,24,28-29H,5-6,9-13H2/t20-,24+,25+,26-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = ZHVWWEYETMPAMX-IFKAHUTRSA-N

Naltriben is a potent and selective antagonist for the delta opioid receptor, which is used in scientific research. It has similar effects to the more widely used δ antagonist naltrindole, but with different binding affinity for the δ1 and δ2 subtypes, which makes it useful for distinguishing the subtype selectivity of drugs acting at the δ receptors. It also acts as a κ-opioid agonist at high doses.

References

References

  1. (May 1991). "Differential antagonism of delta opioid agonists by naltrindole and its benzofuran analog (NTB) in mice: evidence for delta opioid receptor subtypes". The Journal of Pharmacology and Experimental Therapeutics.
  2. (1994). "Delta antagonist and kappa agonist activity of Naltriben: evidence for differential kappa interaction with the delta 1 and delta 2 opioid receptor subtypes". Life Sciences.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

delta-opioid-receptor-antagonistsdibenzofurans4,5-epoxymorphinanshydroxyarenestertiary-alcoholskappa-opioid-receptor-agonistssemisynthetic-opioidscyclopropyl-compounds