Nafenopin


title: "Nafenopin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["lipid-lowering-agents", "tetralins", "phenol-ethers"] topic_path: "general/lipid-lowering-agents" source: "https://en.wikipedia.org/wiki/Nafenopin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 462258191 | ImageFile = Nafenopin.svg | ImageClass = skin-invert-image | IUPACName = 2-Methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoic acid | OtherNames = Nafenoic acid |Section1={{Chembox Identifiers | UNII_Ref = | UNII = 093W78U96W | InChI = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22) | InChIKey1 = XJGBDJOMWKAZJS-UHFFFAOYSA-N | InChI1 = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22) | CASNo = 3771-19-5 | CASNo_Ref = | PubChem = 19592 | ChEBI_Ref = | ChEBI = 7449 | ChEMBL_Ref = | ChEMBL = 1909070 | ChemSpiderID_Ref = | ChemSpiderID = 18456 | KEGG_Ref = | KEGG = C11371 | StdInChIKey_Ref = | StdInChIKey = XJGBDJOMWKAZJS-UHFFFAOYSA-N | SMILES = O=C(O)C(Oc1ccc(cc1)C3c2ccccc2CCC3)(C)C | StdInChI_Ref = | StdInChI = 1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22) |Section2={{Chembox Properties | C=20 | H=22 | O=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

References

References

  1. (1977). "The Choleretic Effect of Nafenopin". Elsevier.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

lipid-lowering-agentstetralinsphenol-ethers