Myricitrin


title: "Myricitrin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["flavonol-rhamnosides"] topic_path: "general/flavonol-rhamnosides" source: "https://en.wikipedia.org/wiki/Myricitrin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 401011564 | Name = Myricitrin | ImageFile = Myricitrin.svg | ImageSize = 250px | ImageName = Myricitrin structure | IUPACName = 3′,4′,5,5′,7-Pentahydroxy-3-(α-L-rhamnopyranosyloxy)flavone | SystematicName = 5,7-Dihydroxy-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one | OtherNames= Myricitroside Myricitrine Myricetrin Myricetol 3-rhamnoside Myricetin 3-O-rhamnoside Myricetin 3-rhamnoside |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 17912-87-7 | ChemSpiderID_Ref = | ChemSpiderID = 4444992 | ChEBI_Ref = | ChEBI = 70082 | ChEMBL_Ref = | ChEMBL = 454576 | EC_number = 241-856-7 | KEGG_Ref = | KEGG = C10108 | PubChem = 5281673 | UNII_Ref = | UNII = 5Z0ZO61WPJ | StdInChI=1S/C21H20O12/c1-6-14(26)17(29)18(30)21(31-6)33-20-16(28)13-9(23)4-8(22)5-12(13)32-19(20)7-2-10(24)15(27)11(25)3-7/h2-6,14,17-18,21-27,29-30H,1H3/t6-,14-,17+,18+,21-/m0/s1 | StdInChIKey = DCYOADKBABEMIQ-OWMUPTOHSA-N | SMILES = CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C(=C4)O)O)O)O)O)O |Section2={{Chembox Properties | Formula = C21H20O12 | MolarMass = 464.37 g/mol | Density = 1.882 g/mL | MeltingPt = | BoilingPt = Myricitrin is a plant compound, the 3-O-α-L-rhamnopyranoside of myricetin.

Occurrences

It can be isolated from the root bark of Myrica cerifera (bayberry, a small tree native to North America), in Myrica esculenta, in Nymphaea lotus and N. odorata, in Chrysobalanus icaco and in Polygonum aviculare.

Myricitrin is used by several beetle species in their communication system. These include Plagioderma versicolora, Agelastica coerulea, Atrachya menetrisi, Altica nipponica, Altica oleracea, Gastrolina depressa.

Pharmacology

Myricitrin is a nitric oxide and protein kinase C inhibitor and exhibits antipsychotic-like and anxiolytic-like effects in animal models of psychosis and anxiety respectively.

References

References

  1. "Myricetin 3-rhamnoside".
  2. (2003). "Two very unusual macrocyclic flavonoids from the water lily Nymphaea lotus". Phytochemistry.
  3. (2006). "Determination of myricetin derivatives in Chrysobalanus icaco L. (Chrysobalanaceae)". Revista Brasileira de Farmacognosia.
  4. LC Method for Analysis of Three Flavonols in Rat Plasma and Urine after Oral Administration of Polygonum aviculare Extract. Fuquan Xu, Huashi Guan, Guoqiang Li and Hongbing Liu, Chromatographia, June 2009, Volume 69, Issue 11-12, pages 1251-1258, {{doi. 10.1365/s10337-009-1088-x
  5. [http://www.pherobase.com/database/compound/compounds-detail-myricitrin.php Myricitrin on pherobase.com]
  6. (August 2011). "Myricitrin, a nitric oxide and protein kinase C inhibitor, exerts antipsychotic-like effects in animal models". Progress in Neuro-Psychopharmacology & Biological Psychiatry.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

flavonol-rhamnosides