Morazone

Quality 0.50 · 1 view · Updated 2 months ago

NSAID analgesic drug

title: "Morazone" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["beta-hydroxyamphetamines", "designer-prodrugs", "nonsteroidal-anti-inflammatory-drugs", "norepinephrine-dopamine-releasing-agents", "phenylmorpholines", "pyrazolones", "stimulants"] description: "NSAID analgesic drug" topic_path: "general/beta-hydroxyamphetamines" source: "https://en.wikipedia.org/wiki/Morazone" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary NSAID analgesic drug ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 458950781 | IUPAC_name = 1,5-dimethyl-4-[(3-methyl-2-phenylmorpholin-4-yl)methyl]-2-phenyl-1,2-dihydro-3H-pyrazol-3-one | image = Morazone.png | image_class = skin-invert-image

| tradename = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = Oral, SC, IM

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 6536-18-1 | ATC_prefix = none | ATC_suffix = | StdInChI_Ref = | StdInChI = 1S/C23H27N3O2/c1-17-21(23(27)26(24(17)3)20-12-8-5-9-13-20)16-25-14-15-28-22(18(25)2)19-10-6-4-7-11-19/h4-13,18,22H,14-16H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = OOGNFQMTGRZRAB-UHFFFAOYSA-N | PubChem = 39609 | ChemSpiderID_Ref = | ChemSpiderID = 36216 | UNII_Ref = | UNII = 870Q5BL2FN

| C=23 | H=27 | N=3 | O=2 | smiles = c1ccccc1N2N(C)C(C)=C(C2=O)CN3CCOC(C3C)c4ccccc4

Morazone (Novartrina, Orsimon, Rosimon-Neu, Tarcuzate) is a nonsteroidal anti-inflammatory drug (NSAID), originally developed by the German pharmaceutical company Ravensberg in the 1950s, which is used as an analgesic. It produces phenmetrazine as a major metabolite and has been reported to have been abused as a recreational drug in the past.

References

References

  1. (1991). "Drug dosage in Renal Insufficiency". Kluwer Academic Publishers.
  2. "Substituted 1-phenyl-2,3-dimethyl-4-morpholino methyl pyrazolone-(5) Compounds and Process of Making Same".
  3. (1996). "Dictionary of Organic Compounds". Chapman & Hall.
  4. (1984). "Some new urinary metabolites of famprofazone and morazone in man". Journal of Pharmaceutical and Biomedical Analysis.
  5. (May 1984). "[Pellagra in morazone abuse]". Zeitschrift für Hautkrankheiten.
  6. (1972). "[ROSIMON-NEU--a non-prescription analgesic on the adolescent drug scene]". Beiträge zur Gerichtlichen Medizin.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

beta-hydroxyamphetaminesdesigner-prodrugsnonsteroidal-anti-inflammatory-drugsnorepinephrine-dopamine-releasing-agentsphenylmorpholinespyrazolonesstimulants