Mitraphylline

Quality 0.50 · 1 view · Updated 2 months ago

title: "Mitraphylline" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["indole-alkaloids", "mitragyna-alkaloids", "spiro-compounds"] topic_path: "general/indole-alkaloids" source: "https://en.wikipedia.org/wiki/Mitraphylline" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 424765806 | Name = Mitraphylline | ImageFile = Mitraphylline.svg | ImageClass = skin-invert-image | ImageName = Mitraphylline | IUPACName = Methyl 19α-methyl-2-oxoformosanan-16-carboxylate | SystematicName = Methyl (1′S,3R,4′aS,5′aS,10′aR)-1′-methyl-2-oxo-1,2,4′a,5′,5′a,7′,8′,10′a-octahydro-1′H,10′H-spiro[indole-3,6′-pyrano[3,4-f]indolizine]-4′-carboxylate |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 509-80-8 | EINECS = 208-106-0 | PubChem = 94160 | ChemSpiderID_Ref = | ChemSpiderID = 84977 | UNII_Ref = | UNII = 1H9SRL2456 | ChEMBL_Ref = | ChEMBL = 2135897 | KEGG_Ref = | KEGG = C09227 | SMILES = C[C@H]1[C@H]2CN3CC[C@]4([C@@H]3C[C@@H]2C(=CO1)C(=O)OC)C5=CC=CC=C5NC4=O | StdInChI_Ref = | StdInChI = 1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13-,14+,18-,21+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = JMIAZDVHNCCPDM-DAFCLMLCSA-N |Section2={{Chembox Properties | Formula = C21H24N2O4 | MolarMass = 368.1736 g/mol | Density = | MeltingPt = | BoilingPt =

Mitraphylline, an oxindole derivative, is an active alkaloid in the leaves of the tree Mitragyna speciosa, commonly known as kratom. As a non-narcotic constituent, it also occurs in the bark of Uncaria tomentosa (cat's claw) along with isomeric alkaloids.

References

References

  1. (May 2014). "Evaluation of ''In Vitro'' Absorption, Distribution, Metabolism, and Excretion (ADME) Properties of Mitragynine, 7-Hydroxymitragynine, and Mitraphylline". Planta Medica.
  2. (December 1992). "HPLC analysis of the main oxindole alkaloids from ''Uncaria tomentosa''". Chromatographia.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

indole-alkaloidsmitragyna-alkaloidsspiro-compounds