Mepyramine

---

title: "Mepyramine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["2-pyridyl-compounds", "h1-receptor-antagonists", "muscarinic-antagonists", "4-methoxyphenyl-compounds", "sigma-receptor-modulators", "dimethylamino-compounds", "over-the-counter-drugs-in-the-united-states"] description: "First generation antihistamine" topic_path: "geography/united-states" source: "https://en.wikipedia.org/wiki/Mepyramine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary First generation antihistamine ::

| Verifiedfields = changed | class = First-generation antihistamine | verifiedrevid = 408591350 | IUPAC_name = N-(4-methoxybenzyl)-N',N'-dimethyl-N-pyridin-2-ylethane-1,2-diamine | image = Mepyramine.svg | image_class = skin-invert-image

| tradename = | Drugs.com = | MedlinePlus = a606008 | pregnancy_category = | legal_status = OTC | routes_of_administration = By mouth, topical

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 91-84-9 | CAS_supplemental = (maleate) | ATC_prefix = R06 | ATC_suffix = AC01 | ATC_supplemental = | PubChem = 4992 | IUPHAR_ligand = 1227 | DrugBank_Ref = | DrugBank = DB06691 | ChemSpiderID_Ref = | ChemSpiderID = 4818 | UNII_Ref = | UNII = HPE317O9TL | KEGG_Ref = | KEGG = D08183 | ChEBI_Ref = | ChEBI = 6762 | ChEMBL_Ref = | ChEMBL = 511 | synonyms = Pyrilamine; N-[2-(dimethylamino)ethyl]-N-[(4-methoxyphenyl)methyl]pyridin-2-amine

| C = 17 | H = 23 | N = 3 | O = 1 | SMILES = O(c1ccc(cc1)CN(c2ncccc2)CCN(C)C)C | StdInChI_Ref = | StdInChI = 1S/C17H23N3O/c1-19(2)12-13-20(17-6-4-5-11-18-17)14-15-7-9-16(21-3)10-8-15/h4-11H,12-14H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = YECBIJXISLIIDS-UHFFFAOYSA-N

Mepyramine, also known as pyrilamine, is a first-generation antihistamine, targeting the H1 receptor as an inverse agonist. Mepyramine rapidly permeates the brain, often causing drowsiness. |url= https://go.drugbank.com/drugs/DB06691 |title =Mepyramine |access-date = 8 May 2021 |website=drugbank.com It is often sold as a maleate salt, pyrilamine maleate.

The medication has negligible anticholinergic activity, with 130,000-fold selectivity for the histamine H1 receptor over the muscarinic acetylcholine receptors (for comparison, diphenhydramine had 20-fold selectivity for the H1 receptor).

It was patented in 1943 and came into medical use in 1949. It was marketed under the names Histadyl, Histalon, Neo-Antergan, Neo-Pyramine, and Nisaval. In the 1960s and 70s it was a very common component in over-the-counter sleep aids such as Alva-Tranquil, Dormin, Sedacaps, Sominex, Nytol, and many others. The US Food and Drug Administration (FDA) included it in the list of chemicals and compounds barred from use in over-the-counter (OTC) nighttime sleep aid products in 1989.

It is used in over-the-counter combination products to treat the common cold and menstrual symptoms such as Midol Complete. It is also the active ingredient of the topical antihistamine creams Anthisan and Neoantergan sold for the treatment of insect bites, stings, and nettle rash.

References

References

1. (March 1987). "Antimuscarinic effects of antihistamines: quantitative evaluation by receptor-binding assay". Japanese Journal of Pharmacology.
2. (2006). "Analogue-based Drug Discovery". John Wiley & Sons.
3. (September 1977). "Sleep aids and sedatives". [[Annals of Emergency Medicine.
4. {{Federal Register. 54. 6826
5. "Active Ingredients for Midol Complete". [[Bayer.
6. "Anthisan Cream - Patient Information Leaflet (PIL)".
7. (January 2006). "Histamine and its receptors". British Journal of Pharmacology.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::