MBBA
title: "MBBA" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["imines", "liquid-crystals", "4-methoxyphenyl-compounds"] topic_path: "general/imines" source: "https://en.wikipedia.org/wiki/MBBA" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Watchedfields = changed | verifiedrevid = 472035275 | ImageFile=MBBA cleaner.svg | ImageAlt = Structural formula of MBBA | ImageFile1 = MBBA molecule ball.png | ImageSize1 = 240 | ImageAlt1 = Ball-and-stick model of the MBBA molecule | PIN = N-(4-Butylphenyl)-1-(4-methoxyphenyl)methanimine | OtherNames = |Section1={{Chembox Identifiers | CASNo=26227-73-6 | CASNo_Ref = | UNII_Ref = | UNII = O69C41149Y | PubChem=33363 | SMILES=CCCCC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC | ChemSpiderID_Ref = | ChemSpiderID = 30817 | InChI = 1/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+ | InChIKey = FEIWNULTQYHCDN-XMHGGMMEBZ | StdInChI_Ref = | StdInChI = 1S/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+ | StdInChIKey_Ref = | StdInChIKey = FEIWNULTQYHCDN-XMHGGMMESA-N |Section2={{Chembox Properties | C=18 | H=21 | N=1 | O=1 | Appearance = Turbid yellow liquid | Density = 1.027 g/mL at 25 °C | MeltingPt= | BoilingPt= | Solubility= |Section3={{Chembox Hazards | MainHazards= | FlashPt = 113 °C (235 °F) | AutoignitionPt= | ExternalSDS = Sigma-Aldrich | NFPA-H = 0 | NFPA-F = 1 | NFPA-R = 0
N-(4-Methoxybenzylidene)-4-butylaniline (MBBA) is an organic compound often used as a liquid crystal.
References
References
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::