LY294002

Quality 0.50 · 2 views · Updated 2 months ago

title: "LY294002" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["4-morpholinyl-compounds", "chromones", "phosphoinositide-3-kinase-inhibitors"] topic_path: "general/4-morpholinyl-compounds" source: "https://en.wikipedia.org/wiki/LY294002" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443344935 | ImageFile = LY294002.svg | ImageClass = skin-invert-image | ImageSize = | PIN=2-(Morpholin-4-yl)-8-phenyl-4H-1-benzopyran-4-one | OtherNames=2-(4-Morpholinyl)-8-phenyl-4H-1-benzopyran-4-one

| Section1 = {{Chembox Identifiers | IUPHAR_ligand = 6004 | CASNo_Ref = | CASNo=154447-36-6 | UNII_Ref = | UNII = 31M2U1DVID | PubChem=3973 | ChEMBL_Ref = | ChEMBL = 98350 | SMILES=C1COCCN1C2=CC(=O)C3=C(O2)C(=CC=C3)C4=CC=CC=C4 | ChemSpiderID_Ref = | ChemSpiderID = 3835 | InChI = 1/C19H17NO3/c21-17-13-18(20-9-11-22-12-10-20)23-19-15(7-4-8-16(17)19)14-5-2-1-3-6-14/h1-8,13H,9-12H2 | InChIKey = CZQHHVNHHHRRDU-UHFFFAOYAM | StdInChI_Ref = | StdInChI = 1S/C19H17NO3/c21-17-13-18(20-9-11-22-12-10-20)23-19-15(7-4-8-16(17)19)14-5-2-1-3-6-14/h1-8,13H,9-12H2 | StdInChIKey_Ref = | StdInChIKey = CZQHHVNHHHRRDU-UHFFFAOYSA-N

| Section2 = {{Chembox Properties | C = 19 | H = 17 | N = 1 | O = 3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility =

| Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

LY294002 is a morpholine-containing chemical compound that is a potent inhibitor of numerous proteins, and a strong inhibitor of phosphoinositide 3-kinases (PI3Ks). It is generally considered a non-selective research tool, and should not be used for experiments aiming to target PI3K uniquely.

Two of these are the proto-oncogene serine/threonine-protein kinase (PIM1) and the phosphatidylinositol-4,5-bisphosphate 3-kinase P110 gamma|catalytic subunit gamma isoform. With an IC50 of 1.4 μM it is somewhat less potent than wortmannin, another well-known PI3 kinase inhibitor. However, LY294002 is a reversible inhibitor of PI3K whereas wortmannin acts irreversibly.

Application of LY294002 causes a substantial acceleration of MEPP frequency (150 μM) at the frog neuromuscular junction through a mechanism that is independent of intraterminal calcium. LY294002 causes the release of MEPPs through a perturbation of synaptotagmin function.

LY294002 is also a BET inhibitor (e.g. of BRD2, BRD3, and BRD4).

Application

Research

It has been shown that LY294002 administration has an additive effect on quercetin antiviral activity against hepatitis C virus.

References

References

  1. (February 2009). "PI3K inhibitors for cancer treatment: where do we stand?". Biochemical Society Transactions.
  2. (August 2015). "The promise and peril of chemical probes". Nature Chemical Biology.
  3. "LY294002". DrugBank.
  4. (February 1994). "A specific inhibitor of phosphatidylinositol 3-kinase, 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one (LY294002)". The Journal of Biological Chemistry.
  5. (December 2005). "LY 294002 inhibits adenosine receptor activation by a mechanism independent of effects on PI-3 kinase or casein kinase II". Purinergic Signalling.
  6. (February 2014). "The commonly used PI3-kinase probe LY294002 is an inhibitor of BET bromodomains". ACS Chemical Biology.
  7. (March 2014). "Modulation of PI3K-LXRα-dependent lipogenesis mediated by oxidative/nitrosative stress contributes to inhibition of HCV replication by quercetin". Laboratory Investigation; A Journal of Technical Methods and Pathology.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

4-morpholinyl-compoundschromonesphosphoinositide-3-kinase-inhibitors