Lufenuron

title: "Lufenuron" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["veterinary-drugs", "insecticides", "ureas", "antifungals", "chloroarenes", "organofluorides", "phenol-ethers", "benzamides", "dog-medications", "fungicides", "fluoroarenes", "trifluoromethyl-compounds"] topic_path: "general/veterinary-drugs" source: "https://en.wikipedia.org/wiki/Lufenuron" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 462094340 | ImageFile = Lufenuron 200.svg | ImageSize = | ImageFile2 = Lufenuron-3D-balls.png | ImageSize2 = | IUPACName = 1-[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-(2,6-difluorobenzoyl)urea | OtherNames = N-[[[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide Fluphenacur U.S. EPA PC Code: 118205 |Section1={{Chembox Identifiers | UNII_Ref = | UNII = 1R754M4918 | Abbreviations = | ChemSpiderID_Ref = | ChemSpiderID = 64813 | ChEMBL_Ref = | ChEMBL = 1364906 | InChI = 1/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) | InChIKey = PWPJGUXAGUPAHP-UHFFFAOYAQ | StdInChI_Ref = | StdInChI = 1S/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) | StdInChIKey_Ref = | StdInChIKey = PWPJGUXAGUPAHP-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 103055-07-8 | EINECS = | PubChem = 71777 | SMILES = Clc1cc(c(Cl)cc1OC(F)(F)C(F)C(F)(F)F)NC(=O)NC(=O)c2c(F)cccc2F | RTECS = | MeSHName = | ChEBI_Ref = | ChEBI = 39384 | KEGG_Ref = | KEGG = D08150 |Section2={{Chembox Properties | C=17 | H=8 | Cl=2 | F=8 | N=2 | O=3 | Appearance = | Density = | MeltingPtC = 174 | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | pKa = | pKb = |Section6={{Chembox Pharmacology | ATCvet = yes | ATCCode_prefix = P53 | ATCCode_suffix = BC01 |Section7={{Chembox Hazards | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | PEL =
Lufenuron is the active ingredient in the veterinary flea control medication program, and one of the two active ingredients in the flea, heartworm, and anthelmintic medicine milbemycin oxime/lufenuron (Sentinel).
Lufenuron is stored in the animal's body fat and transferred to adult fleas through the host's blood when they feed. Adult fleas transfer it to their growing eggs through their blood, and to hatched larvae feeding on their excrement. It does not kill adult fleas.
Lufenuron, a benzoylurea pesticide, inhibits the production of chitin in insects. Without chitin, a larval flea will never develop a hard outer shell (exoskeleton). With its inner organs exposed to air, the insect dies from dehydration soon after hatching or molting (shedding its old, smaller shell).
Lufenuron is also used to fight fungal infections, since fungus cell walls are about one third chitin.
Lufenuron is also sold as an agricultural pesticide for use against lepidopterans, eriophyid mites, and western flower thrips. It is an effective antifungal in plants.
References
References
- (2000). "Use of lufenuron for treating fungal infections of dogs and cats: 297 cases (1997-1999)". Journal of the American Veterinary Medical Association.
- (2014). "The Pesticide Encyclopedia". CABI.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::