Losindole

Tricyclic antidepressant


title: "Losindole" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["tricyclic-antidepressants", "pyrrolidines", "chloroarenes", "abandoned-drugs"] description: "Tricyclic antidepressant" topic_path: "arts/music" source: "https://en.wikipedia.org/wiki/Losindole" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Tricyclic antidepressant ::

| IUPAC_name = (3aS,4R,9aR)-6-chloro-2-methyl-4-phenyl-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]isoindole | image = Losindole.png | image_class = skin-invert-image

| tradename = | pregnancy_category = | legal_status = Uncontrolled | routes_of_administration = Oral

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number = 69175-77-5 | ATC_prefix = none | ATC_suffix = | PubChem = 3045392 | ChemSpiderID = 2308134 | UNII_Ref = | UNII = IX8TM6153H

| C=19 | H=20 | Cl=1 | N=1 | smiles = Clc1ccc3c(c1)C@@H[C@H]4C@@HCN(C4)C

Losindole (BI-27,062) is an antidepressant with a tricyclic structure. It was never marketed.

References

References

  1. "Losindole".
  2. (1996). "Dictionary of Pharmacological Agents". Chapman & Hall/CRC.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

tricyclic-antidepressantspyrrolidineschloroarenesabandoned-drugs