Levosulpiride
Dopamine antagonist medication
title: "Levosulpiride" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["5-ht4-agonists", "antidepressants", "antiemetics", "antipsychotics", "benzamides", "d2-antagonists", "enantiopure-drugs", "ghb-receptor-ligands", "motility-stimulants", "phenol-ethers", "pyrrolidines", "sulfonamides", "typical-antipsychotics"] description: "Dopamine antagonist medication" topic_path: "general/5-ht4-agonists" source: "https://en.wikipedia.org/wiki/Levosulpiride" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Dopamine antagonist medication ::
::data[format=table title="Infobox drug"]
| Field | Value |
|---|---|
| Verifiedfields | verified |
| Watchedfields | verified |
| verifiedrevid | 443990153 |
| image | Levosulpiride.svg |
| image_class | skin-invert-image |
| tradename | Dislep, Sulpepta, others |
| pregnancy_AU | |
| pregnancy_US | |
| routes_of_administration | Oral |
| ATC_prefix | N05 |
| ATC_suffix | AL07 |
| legal_AU | |
| legal_BR | |
| legal_CA | |
| legal_DE | |
| legal_NZ | |
| legal_UK | |
| legal_US | |
| legal_UN | |
| legal_status | |
| CAS_number | 23672-07-3 |
| PubChem | 688272 |
| IUPHAR_ligand | 958 |
| DrugBank | DB16021 |
| ChemSpiderID | 599749 |
| UNII | JTG7R315LK |
| KEGG | D07312 |
| ChEBI | 64119 |
| ChEMBL | 267044 |
| DTXSID | DTXSID0042583 |
| synonyms | L-Sulpiride; S-(–)-Sulpiride; RV-12309 |
| IUPAC_name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-methoxy-5-sulfamoylbenzamide |
| C | 15 |
| SMILES | CCN1CCC[C@H]1CNC(=O)C2=C(C=CC(=C2)S(=O)(=O)N)OC |
| StdInChI | 1S/C15H23N3O4S/c1-3-18-8-4-5-11(18)10-17-15(19)13-9-12(23(16,20)21)6-7-14(13)22-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,17,19)(H2,16,20,21)/t11-/m0/s1 |
| StdInChIKey | BGRJTUBHPOOWDU-NSHDSACASA-N |
| :: |
| Verifiedfields = verified | Watchedfields = verified | verifiedrevid = 443990153 | drug_name = | image = Levosulpiride.svg | image_class = skin-invert-image | alt = | caption =
| pronounce = | tradename = Dislep, Sulpepta, others | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_AU_comment = | pregnancy_US = | pregnancy_category = | routes_of_administration = Oral | ATC_prefix = N05 | ATC_suffix = AL07
| legal_AU = | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = | legal_DE = | legal_NZ = | legal_UK = | legal_US = | legal_UN = | legal_status =
| bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
| CAS_number = 23672-07-3 | CAS_supplemental = | PubChem = 688272 | IUPHAR_ligand = 958 | DrugBank = DB16021 | ChemSpiderID = 599749 | UNII = JTG7R315LK | KEGG = D07312 | ChEBI = 64119 | ChEMBL = 267044 | DTXSID = DTXSID0042583 | synonyms = L-Sulpiride; S-(–)-Sulpiride; RV-12309
| IUPAC_name = N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-methoxy-5-sulfamoylbenzamide | C=15 | H=23 | N=3 | O=4 | S=1 | SMILES = CCN1CCC[C@H]1CNC(=O)C2=C(C=CC(=C2)S(=O)(=O)N)OC | StdInChI = 1S/C15H23N3O4S/c1-3-18-8-4-5-11(18)10-17-15(19)13-9-12(23(16,20)21)6-7-14(13)22-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,17,19)(H2,16,20,21)/t11-/m0/s1 | StdInChIKey = BGRJTUBHPOOWDU-NSHDSACASA-N
Levosulpiride, sold under the brand names Dislep and Sulpepta among others, is a dopamine antagonist medication which is used in the treatment of psychotic disorders like schizophrenia, major depressive disorder, nausea and vomiting, and gastroparesis. It is taken by mouth.
It is a selective antagonist of the dopamine D2 receptor and an agonist of the serotonin 5-HT4 receptor. Chemically, it is a benzamide and the (S)-(−)-enantiomer of sulpiride.
Levosulpiride is marketed widely throughout the world, including in Europe, South Korea, Latin America, India, and Pakistan. It is not available in the United States or the United Kingdom.
Medical uses
Levosulpiride is used in the treatment of:
- Psychosis
- Negative symptoms of schizophrenia
- Major depressive disorder
- Anxiety disorders
- Dysthymia
- Vertigo
- Nausea and vomiting
- Gastroparesis
- Dyspepsia
- Irritable bowel syndrome
- Premature ejaculation
Levosulpiride is not currently licensed for treatment of premature ejaculation in the United Kingdom or other European countries.
Side effects
Side effects of levosulpiride include amenorrhea, gynecomastia, galactorrhea, changes in libido, and neuroleptic malignant syndrome. In the United States, as of 2013 only one case of adverse reaction to levosulpiride had been recorded on the FDA Adverse Event Reporting System Database. A case of rapid-onset resistant dystonia caused by low-dose levosulpiride was reported in India.
Pharmacology
Pharmacodynamics
Levosulpiride is a selective dopamine D2 receptor antagonist. The drug has also been found to act as a moderate agonist of the serotonin 5-HT4 receptor. It is said to have antipsychotic, antidepressant, antiemetic, and gastroprokinetic effects.
Chemistry
Levosulpiride is a substituted benzamide derivative. It is the levorotatory enantiomer of sulpiride. Other benzamide derivatives include amisulpride, metoclopramide, tiapride, sultopride, and veralipride, among others.
References
References
- (24 October 2021). "Levosulpiride".
- (6 October 2024). "Levosulpiride (International database)".
- (February 1995). "Levosulpiride: a review of its clinical use in psychiatry". Pharmacol Res.
- (February 1995). "Pharmacotoxicological aspects of levosulpiride". Pharmacol Res.
- (April 2003). "5-HT4 receptors contribute to the motor stimulating effect of levosulpiride in the guinea-pig gastrointestinal tract". Dig Liver Dis.
- (2022). "Levosulpiride for Premature Ejaculation: A Systematic Review and Meta-Analysis". Am J Mens Health.
- (August 2002). "Levosulpiride: a new solution for premature ejaculation?". Int J Impot Res.
- "Levosulpiride drug information". DrugsUpdate India.
- (June 2013). "Antipsychotics and torsadogenic risk: signals emerging from the US FDA Adverse Event Reporting System database". Drug Safety.
- (January 2007). "Rapid onset resistant dystonia with low dose of Levosulpiride.". British Journal of Psychiatry.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::