Lanosterol


title: "Lanosterol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["sterols", "triterpenes", "lanostanes", "membrane-biology"] topic_path: "science/biology" source: "https://en.wikipedia.org/wiki/Lanosterol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 393354387 | ImageFile = Lanosterol skeletal.svg | ImageSize = 250 | ImageFile2 = Lanosterol molecule ball.png | ImageSize2 = 250 | ImageAlt2 = Ball-and-stick model of lanosterol | IUPACName = Lanosta-8,24-dien-3β-ol | SystematicName = (1R,3aR,5aR,7S,9aS,11aR)-3a,6,6,9a,11a-Pentamethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,3a,4,5,5a,6,7,8,9,9a,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 79-63-0 | Beilstein = 2226449 | ChEBI_Ref = | ChEBI = 16521 | ChEMBL_Ref = | ChEMBL = 225111 | ChemSpiderID_Ref = | ChemSpiderID = 216175 | DrugBank = DB03696 | EC_number = 201-214-9 | IUPHAR_ligand = 2746 | KEGG = C01724 | MeSHName = Lanosterol | PubChem = 246983 | UNII_Ref = | UNII = 1J05Z83K3M | InChI = 1/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 | InChIKey = CAHGCLMLTWQZNJ-BQNIITSRBP | StdInChI_Ref = | StdInChI = 1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = CAHGCLMLTWQZNJ-BQNIITSRSA-N | SMILES = CC@H[C@H]1CC[C@]2(C)C1CCC3=C2CC[C@H]4C(C)(C)C@@HCC[C@]34C |Section2={{Chembox Properties | Formula = C30H50O | MolarMass = 426.71 g/mol | Appearance = | Density = | MeltingPtC = 138 to 140 | MeltingPt_notes = | BoilingPt = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = Lanosterol is a tetracyclic triterpenoid and is the compound from which all animal and fungal steroids are derived. By contrast, plant steroids are produced via cycloartenol. In the eyes of vertebrates, lanosterol is a natural constituent, having a role in maintaining health of the lens. Lanosterol is the precursor to cholesterol.

Biosynthesis

The biosynthesis of lanosterol has been intensively investigated. ::data[format=table]

DescriptionIllustrationEnzyme
Two molecules of farnesyl pyrophosphate condense with reduction by NADPH to form squalene[[Image:Cholesterol-Synthesis-Reaction10.png400px]]
Squalene is oxidized to 2,3-oxidosqualene (squalene epoxide)[[File:Squalene epoxide biosynthesis.png400x400px]]
2,3-Oxidosqualene is converted to a protosterol cation and finally to lanosterol[[Image:Cholesterol-Synthesis-Reaction12.png400px]]
(step 2)[[Image:Cholesterol-Synthesis-Reaction13.png400px]]
::

Elaboration of lanosterol under enzyme catalysis leads to other steroids. 14-Demethylation of lanosterol by CYP51 eventually yields cholesterol. ::figure[src="https://upload.wikimedia.org/wikipedia/commons/1/18/Sterol_synthesis.svg" caption="Simplified version of the lanosterol synthesis pathway with the intermediates [[isopentenyl pyrophosphate]] (IPP), [[dimethylallyl pyrophosphate]] (DMAPP), [[geranyl pyrophosphate]] (GPP), and [[squalene]] shown. Some intermediates are omitted."] ::

Research as an eye drop supplement

As a molecule naturally enriched in the eye lens, lanosterol is a component involved in maintenance of lens clarity. Its proposed mechanism of action is to inhibit the aggregation of crystallin proteins, which contribute to the clouding of vision by forming cataracts.

Lanosterol is under research for its potential as a therapeutic additive in eye drops to inhibit the aggregation of crystallin proteins and dissolve cataracts. However, supplemental lanosterol in eye drops appears to have limited solubility and poor bioavailability in the eye, and has not proved effective for inhibiting cataracts, as of 2020.

References

References

  1. (May 2003). "The role of sterols in plant growth and development". Progress in Lipid Research.
  2. (2011). "Biosynthesis of cholesterol and other sterols". Chemical Reviews.
  3. (June 2019). "Failure of oxysterols such as lanosterol to restore lens clarity from cataracts". Scientific Reports.
  4. (November 2020). "Advances in pharmacotherapy of cataracts". Annals of Translational Medicine.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

sterolstriterpeneslanostanesmembrane-biology