Ketazocine

Quality 0.50 · 2 views · Updated 2 months ago

Chemical compound

title: "Ketazocine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["benzomorphans", "hallucinogenic-kappa-opioid-receptor-agonists", "ketones", "hydroxyarenes", "synthetic-opioids"] description: "Chemical compound" topic_path: "general/benzomorphans" source: "https://en.wikipedia.org/wiki/Ketazocine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| verifiedrevid = 443949789 | IUPAC_name = (2S,6R,11R)-3-(cyclopropylmethyl)-8-hydroxy-6,11-dimethyl-3,4,5,6-tetrahydro-2,6-methano-3-benzazocin-1(2H)-one | image = Ketazocine structure.svg | image_class = skin-invert-image

| tradename = | pregnancy_category = | legal_status = | routes_of_administration = Oral

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 36292-69-0 | ATC_prefix = none | ATC_suffix = | PubChem = 3054741 | ChemSpiderID_Ref = | ChemSpiderID = 2316328 | UNII_Ref = | UNII = 6IO4IG518S | KEGG_Ref = | KEGG = D04649

| C=18 | H=23 | N=1 | O=2 | smiles = O=C2c1c(cc(O)cc1)[C@]3(C@HC)C | StdInChI_Ref = | StdInChI = 1S/C18H23NO2/c1-11-16-17(21)14-6-5-13(20)9-15(14)18(11,2)7-8-19(16)10-12-3-4-12/h5-6,9,11-12,16,20H,3-4,7-8,10H2,1-2H3/t11-,16-,18+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = HQBZLVPZOGIAIQ-SDDDUWNISA-N Ketazocine (INN), also known as ketocyclazocine, is a benzomorphan derivative used in opioid receptor research. Ketazocine, for which the receptor is named, is an exogenous opioid that binds to the κ opioid receptor.

Activation of this receptor is known to cause sleepiness, a decrease in pain sensation and (potentially) dysphoria, paranoia, and hallucinations. It also causes an increase in urine production because it inhibits the release of vasopressin.

Unlike other opioids, substances that only bind to the κ receptor theoretically do not depress the respiratory system.

The crystal structure of ketazocine was determined in 1983.

References

References

  1. (September 1982). "Effects of ketazocine, ethylketazocine and phenazocine on schedule-controlled behavior: antagonism by naloxone". Neuropharmacology.
  2. (1983). "(1S, 5R, 9R)-2-Cyclopropylmethyl-2'-hydroxy-5, 9-dimethyl-8-oxo-6, 7-benzomorphan hydrochloride monohydrate (ketazocine), C18H23NO2. HCl. H2O". Acta Crystallogr. C.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

benzomorphanshallucinogenic-kappa-opioid-receptor-agonistsketoneshydroxyarenessynthetic-opioids