Jervine


title: "Jervine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["teratogens", "jervines", "spiro-compounds", "secondary-alcohols", "ketones", "oxygen-heterocycles", "nitrogen-heterocycles", "plant-toxins"] topic_path: "general/teratogens" source: "https://en.wikipedia.org/wiki/Jervine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 461783099 | Name = Jervine | ImageFile_Ref = | ImageFile = Jervine.png | ImageSize = | ImageName = | IUPACName = 3β-Hydroxy-17β,23β-epoxyveratraman-11-one | SystematicName = (2′R,3S,3′R,3′aS,6′S,6aS,6bS,7′aR,11aS,11bR)-3-Hydroxy-3′,6′,10,11b-tetramethyl-2,3,3′a,4,4′,5′,6,6′,6a,6b,7,7′,7′a,8,11a,11b-hexadecahydro-3′H-spiro[benzo[a]fluorene-9,2′-furo[3,2-b]pyridin]-11(1H)-one | OtherNames = (3β,23β)-17,23-Epoxy-3-hydroxyveratraman-11-one | Section1 = {{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 9694 | PubChem = 10098 | ChEMBL_Ref = | ChEMBL = 186779 | InChI = 1/C27H39NO3/c1-14-11-21-24(28-13-14)16(3)27(31-21)10-8-19-20-6-5-17-12-18(29)7-9-26(17,4)23(20)25(30)22(19)15(27)2/h5,14,16,18-21,23-24,28-29H,6-13H2,1-4H3/t14-,16+,18-,19-,20-,21+,23+,24-,26-,27-/m0/s1 | InChIKey = CLEXYFLHGFJONT-DNMILWOZBJ | StdInChI_Ref = | StdInChI = 1S/C27H39NO3/c1-14-11-21-24(28-13-14)16(3)27(31-21)10-8-19-20-6-5-17-12-18(29)7-9-26(17,4)23(20)25(30)22(19)15(27)2/h5,14,16,18-21,23-24,28-29H,6-13H2,1-4H3/t14-,16+,18-,19-,20-,21+,23+,24-,26-,27-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = CLEXYFLHGFJONT-DNMILWOZSA-N | CASNo_Ref = | CASNo = 469-59-0 | UNII_Ref = | UNII = 19V3ECX465 | SMILES = O=C5/C3=C(/[C@@]1(O[C@@H]2CC@@HC)CC[C@H]3[C@@H]6C/C=C4/CC@@HCC[C@]4(C)[C@@H]56)C | Section2 = {{Chembox Properties | Formula = C27H39NO3 | MolarMass = 425.60 g/mol | SolubleOther = 10 mg/mL in EtOH 6 mg/mL in DMF | Density = | MeltingPt = Jervine is a steroidal alkaloid with molecular formula C27H39NO3 which is derived from the plant genus Veratrum. Similar to cyclopamine, which also occurs in the genus Veratrum, it is a teratogen implicated in birth defects when consumed by animals during a certain period of their gestation. TOC

Physiological effects

Jervine is a potent teratogen causing birth defects in vertebrates. In severe cases it can cause cyclopia and holoprosencephaly.

Mechanism of action

Jervine's biological activity is mediated via its interaction with the 7 pass trans membrane protein smoothened. Jervine binds with and inhibits smoothened, which is an integral part of the hedgehog signaling pathways. With smoothened inhibited, the GLI1 transcription cannot be activated and hedgehog target genes cannot be transcribed.

References

References

  1. (2002). "Inhibition of Hedgehog Signaling by direct binding of Cyclopamine to Smoothened". Genes Dev..

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

teratogensjervinesspiro-compoundssecondary-alcoholsketonesoxygen-heterocyclesnitrogen-heterocyclesplant-toxins