Isorhamnetin

Quality 0.50 · 2 views · Updated 2 months ago

title: "Isorhamnetin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["o-methylated-flavonols", "resorcinols", "tetrols"] topic_path: "general/o-methylated-flavonols" source: "https://en.wikipedia.org/wiki/Isorhamnetin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 400271366 | Name = Isorhamnetin | ImageFile = 3-methylquercetin.svg | ImageSize = 250px | ImageName = Isorhamnetin structure | ImageFile2 = Isorhamnetin.png | ImageSize2 = 250px | ImageName2 = Isorhamnetin 3D structure | IUPACName = 3,4′,5,7-Tetrahydroxy-3′-methoxyflavone | SystematicName = 3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one | OtherNames = 3-methylquercetin 3-Methylquercetin Isorhamnetol isorhamentin isorhamnetine iso-rhamnetin 3'-Methoxyquercetin |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 480-19-3 | PubChem = 5281654 | ChEBI_Ref = | ChEBI = 6052 | ChEMBL_Ref = | ChEMBL = 379064 | UNII_Ref = | UNII = 07X3IB4R4Z | KEGG_Ref = | KEGG = C10084 | ChemSpiderID_Ref = | ChemSpiderID = 4444973 | SMILES = COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O | InChI = 1/C16H12O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 | InChIKey = IZQSVPBOUDKVDZ-UHFFFAOYAD | StdInChI_Ref = | StdInChI = 1S/C16H12O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 | StdInChIKey_Ref = | StdInChIKey = IZQSVPBOUDKVDZ-UHFFFAOYSA-N

|Section2={{Chembox Properties | Formula = C16H12O7 | MolarMass = 316.26 g/mol | Density = | MeltingPtC = 307 | BoilingPt =

Isorhamnetin is an O-methylated flavon-ol from the class of flavonoids. A common food source of this 3'-methoxylated derivative of quercetin and its glucoside conjugates are pungent yellow or red onions, in which it is a minor pigment, quercetin-3,4'-diglucoside and quercetin-4'-glucoside and the aglycone quercetin being the major pigments. Pears, olive oil, wine and tomato sauce are rich in isorhamnetin. Almond skin is a rich source of isorhamnetin-3-O-rutinoside and isorhamnetin-3-O-glucoside, in some cultivars they comprise 75% of the polyphenol content, the total of which can exceed 10 mg/100 gram almond. Others sources include the spice, herbal medicinal and psychoactive Mexican tarragon (Tagetes lucida), which is described as accumulating isorhamnetin and its 7-O-glucoside derivate. Nopal (Opuntia ficus-indica (L.)) is also a good source of isorhamnetin, which can be extracted by supercritical fluid extraction assisted by enzymes.

Metabolism

The enzyme quercetin 3-O-methyltransferase uses S-adenosyl methionine and quercetin to produce S-adenosylhomocysteine and isorhamnetin.

The enzyme 3-methylquercetin 7-O-methyltransferase uses S-adenosyl methionine and 5,7,3',4'-tetrahydroxy-3-methoxyflavone (isorhamnetin) to produce S-adenosylhomocysteine and 5,3',4'-trihydroxy-3,7-dimethoxyflavone (rhamnazin).

Glycosides

References

References

  1. (December 2007). "Onions: a source of unique dietary flavonoids". J. Agric. Food Chem..
  2. (2020-01-29). "Dietary flavonols and risk of Alzheimer dementia". Neurology.
  3. PMID 25544797 PMC4276397
  4. (2006). "Antifungal and Antibacterial Activities of Mexican Tarragon (Tagetes lucida)". Journal of Agricultural and Food Chemistry.
  5. Abdala, 1999
  6. (November 2018). "Supercritical CO2 enzyme hydrolysis as a pretreatment for the release of isorhamnetin conjugates from Opuntia ficus-indica (L.) Mill". The Journal of Supercritical Fluids.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

o-methylated-flavonolsresorcinolstetrols