Ionomycin


title: "Ionomycin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["ionophores", "3-hydroxypropenals", "tetrahydrofurans", "hydroxycarboxylic-acids", "keto-acids"] topic_path: "general/ionophores" source: "https://en.wikipedia.org/wiki/Ionomycin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 400118302 | ImageFile=Ionomycin (free acid).svg | ImageSize=300 | IUPACName=(4R,6S,8S,10Z,12R,14R,16E,18R,19R,20S,21S)-19,21-Dihydroxy-22-{(2S,2R,5S,5S)-5-[(1R)-1-hydroxyethyl]-2,5-dimethyloctahydro-2,2-bifuran-5-yl}-4,6,8,12,14,18,20-heptamethyl-11-oxido-9-oxodocosa-10,16-dienoic acid | OtherNames= |Section1={{Chembox Identifiers | ChEMBL_Ref = | ChEMBL = 501617 | ChEMBL2_Ref = | ChEMBL2 = 1222121 | PubChem = 6912226 | ChemSpiderID_Ref = | ChemSpiderID = 5288579 | SMILES = CC@HCC@HCC@HC(=O)/C=C(/C@HCC@HC/C=C/C@@HC@HO)\O | InChI = 1/C41H72O9/c1-25(21-29(5)34(43)24-35(44)30(6)22-27(3)20-26(2)14-15-38(46)47)12-11-13-28(4)39(48)31(7)36(45)23-33-16-18-41(10,49-33)37-17-19-40(9,50-37)32(8)42/h11,13,24-33,36-37,39,42-43,45,48H,12,14-23H2,1-10H3,(H,46,47)/b13-11+,34-24-/t25-,26-,27+,28-,29-,30+,31+,32-,33+,36+,37-,39-,40+,41+/m1/s1 | InChIKey = PGHMRUGBZOYCAA-ADZNBVRBBY | StdInChI_Ref = | StdInChI = 1S/C41H72O9/c1-25(21-29(5)34(43)24-35(44)30(6)22-27(3)20-26(2)14-15-38(46)47)12-11-13-28(4)39(48)31(7)36(45)23-33-16-18-41(10,49-33)37-17-19-40(9,50-37)32(8)42/h11,13,24-33,36-37,39,42-43,45,48H,12,14-23H2,1-10H3,(H,46,47)/b13-11+,34-24-/t25-,26-,27+,28-,29-,30+,31+,32-,33+,36+,37-,39-,40+,41+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = PGHMRUGBZOYCAA-ADZNBVRBSA-N | CASNo_Ref = | CASNo = 56092-81-0 | UNII_Ref = | UNII = 54V905V6AT |Section2={{Chembox Properties | C=41 | H=72 | O=9 | MolarMass=709.0050 g/mol | Appearance= | Density= | MeltingPt= | BoilingPt= | SolubleOther=insoluble in water, soluble in fats, DMSO, heptane and hexane |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = Ionomycin is an ionophore and an antibiotic that binds calcium ions (Ca2+) in a ratio 1:1. It is produced by the bacterium Streptomyces conglobatus. It binds also other divalent cations like magnesium and cadmium, but binds Ca2+ preferably.

It has 14 chiral centers. Its β-diketone and carboxylic acid group form a chelate with calcium.

It was extracted in 1978 and the complete structure was described in 1979.

It is used in research to raise the intracellular calcium level (Ca2+) and as a research tool to understand Ca2+ transport across biological membranes.

Ionomycin is often sold as a free acid, or as a Ca2+ salt. Both are insoluble in water, but soluble in fats and DMSO. Because of their fat solubility, they bind to proteins like albumin, which may interfere with their use in studies involving blood.

References

References

  1. (2002). "Total synthesis of ionomycin using ring-opening strategies". Organic Letters.
  2. (2010). "Practical aspects of measuring intracellular calcium signals with fluorescent indicators". Methods in Cell Biology.
  3. (1979). "Structure of ionomycin - a novel diacidic polyether antibiotic having high affinity for calcium ions". Journal of the American Chemical Society.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

ionophores3-hydroxypropenalstetrahydrofuranshydroxycarboxylic-acidsketo-acids