Indanol
Indanols are a class of organic compounds, some of which are useful in medicine or industry. They are hydroxy derivatives of the parent compound called indane (also known as indan).
.mw-parser-output .ib-chembox{border-collapse:collapse;text-align:left}.mw-parser-output .ib-chembox td,.mw-parser-output .ib-chembox th{border:1px solid #a2a9b1;width:40%}.mw-parser-output .ib-chembox td+td{width:60%}@media screen{html.skin-theme-clientpref-night .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}@media screen and (prefers-color-scheme:dark){html.skin-theme-clientpref-os .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}
| Identifiers | |
|---|---|
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}1: 6351-10-6 racemic2: 4254-29-94: 1641-41-45: 1470-94-6 |
| 3D model (JSmol) | 1: Interactive image2: Interactive image4: Interactive image5: Interactive image |
| Beilstein Reference | 1:2042960, |
| ChEBI | 1: CHEBI:166975: CHEBI:59311 |
| ChEMBL | 1: ChEMBL45649095: ChEMBL3218378 |
| ChemSpider | 1: 213942: 703264: 668405: 14390 |
| EC Number | 1: 228-755-32: 224-230-84: 216-691-95: 216-006-3 |
| KEGG | 1: C01710 |
| PubChem CID | 1: 228192: 779364: 742335: 15118 |
| UNII | 1: LHG5BD7LOR2: B77NA7SM294: 7PJT17BE055: 9Z94H6F15T |
| CompTox Dashboard (EPA) | 4: DTXSID001677085: DTXSID0051732 |
| InChI | |
| 1: InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2Key: YIAPLDFPUUJILH-UHFFFAOYSA-N2: InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2Key: KMGCKSAIIHOKCX-UHFFFAOYSA-N4: InChI=1S/C9H10O/c10-9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2Key: DPHNJPUOMLRELT-UHFFFAOYSA-N5: InChI=1S/C9H10O/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2Key: PEHSSTUGJUBZBI-UHFFFAOYSA-N | |
| SMILES | |
| 1: OC1CCc2ccccc212: OC1Cc2ccccc2C14: Oc1cccc2c1CCC25: Oc1ccc2c(c1)CCC2 | |
| Chemical formula | C9H10O |
| Molar mass | 134.178 g·mol−1 |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references | |
Indanols are a class of organic compounds, some of which are useful in medicine or industry. They are hydroxy derivatives of the parent compound called indane (also known as indan).
- 1-indanol (racemic), m.p. 54.8; R enantiomer, m.p. 67-68°C
- 2-indanol, m.p. 68-69 °C
- 4-indanol, m.p. 42 °C
- 5-indanol, m.p. 58 °C
Five isomers are possible, two of which are phenols (4- and 5-indanols). Three isomers feature hydroxyl group on the five-membered ring, including an enantiomeric pair of 1-indanol. 1-Indanol can be produced by reduction of 1-indanone. 5-indanol can be prepared by sulfonation of indane, following by base cleavage of the indane-5-sulfonate.