Imazapic

Quality 0.50 · 1 view · Updated 2 months ago

title: "Imazapic" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["herbicides", "isopropyl-compounds", "pyridines", "carboxylic-acids", "group-2-herbicides"] topic_path: "general/herbicides" source: "https://en.wikipedia.org/wiki/Imazapic" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Name = | ImageFile = Imazapic v2.svg | ImageSize = | IUPACName = 5-Methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid | SystematicName = 5-Methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid | OtherNames = |Section1={{Chembox Identifiers | Abbreviations = | CASNo_Ref = | CASNo = 104098-48-8 | UNII_Ref = | UNII = K98N09T10R | EINECS = | PubChem = 91770 | ChEBI = 147366 | ChemSpiderID = 82867 | SMILES = O=C(O)c1c(ncc(c1)C)/C2=N/C(C(=O)N2)(C(C)C)C | InChI = InChI=1S/C14H17N3O3/c1-7(2)14(4)13(20)16-11(17-14)10-9(12(18)19)5-8(3)6-15-10/h5-7H,1-4H3,(H,18,19)(H,16,17,20) | RTECS = | MeSHName = | KEGG = |Section2={{Chembox Properties | C = 14 | H = 17 | N = 3 | O = 3 | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | LogP = | VaporPressure = | HenryConstant = | AtmosphericOHRateConstant = | pKa = | pKb = |Section3={{Chembox Structure | CrystalStruct = | Coordination = | MolShape = |Section4={{Chembox Thermochemistry | DeltaHf = | DeltaHc = | Entropy = | HeatCapacity = |Section5={{Chembox Pharmacology | AdminRoutes = | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_US = |Section6={{Chembox Explosive | ShockSens = | FrictionSens = | DetonationV = | REFactor = |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | LD50 = | PEL = |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds =

Imazapic is a chemical used as an herbicide. It controls many broad leaf weeds and controls or suppresses some grasses in pasture, rangeland and certain types of turf. It has a half-life of around 120 days in soil. Imazapic is considered an environmental hazard due to its harmful effects on aquatic life.

Imazapic's HRAC classification is Group B (global, Aus), Group 2 (numeric), as it inhibits acetohydroxyacid synthase.

References

References

  1. [http://www.invasive.org/gist/products/handbook/16.Imazapic.pdf data pdf sheet]
  2. "toxipedia page".
  3. PubChem. "Imazapic".
  4. "Classification of Herbicides According to Site of Action".

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

herbicidesisopropyl-compoundspyridinescarboxylic-acidsgroup-2-herbicides