Icariin

title: "Icariin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["pde5-inhibitors", "flavonol-glucosides", "flavonol-rhamnosides", "prenylflavonoids", "4-methoxyphenyl-compounds"] topic_path: "general/pde5-inhibitors" source: "https://en.wikipedia.org/wiki/Icariin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | verifiedrevid = 461936642 | ImageFile = Icariin.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageAlt = | IUPACName = 7-(β-D-Glucopyranosyloxy)-5-hydroxy-4′-methoxy-8-(3-methylbut-2-en-1-yl)-3-(α-L-rhamnopyranosyloxy)flavone | SystematicName = 5-Hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-7-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}-4H-1-benzopyran-4-one | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 489-32-7 | CASNo_Ref = | UNII_Ref = | UNII = VNM47R2QSQ | SMILES = O=C3C(\O[C@@H]1OC@HC)=C(/Oc4c(c(O[C@@H]2OC@HC@@HC@H[C@H]2O)cc(O)c34)C\C=C(/C)C)c5ccc(OC)cc5 | InChI = 1/C33H40O15/c1-13(2)5-10-17-19(45-33-28(42)26(40)23(37)20(12-34)46-33)11-18(35)21-24(38)31(48-32-27(41)25(39)22(36)14(3)44-32)29(47-30(17)21)15-6-8-16(43-4)9-7-15/h5-9,11,14,20,22-23,25-28,32-37,39-42H,10,12H2,1-4H3/t14-,20+,22-,23+,25+,26-,27+,28+,32-,33+/m0/s1 | InChIKey = TZJALUIVHRYQQB-XLRXWWTNBA | StdInChI_Ref = | StdInChI = 1S/C33H40O15/c1-13(2)5-10-17-19(45-33-28(42)26(40)23(37)20(12-34)46-33)11-18(35)21-24(38)31(48-32-27(41)25(39)22(36)14(3)44-32)29(47-30(17)21)15-6-8-16(43-4)9-7-15/h5-9,11,14,20,22-23,25-28,32-37,39-42H,10,12H2,1-4H3/t14-,20+,22-,23+,25+,26-,27+,28+,32-,33+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = TZJALUIVHRYQQB-XLRXWWTNSA-N | ChEMBL_Ref = | ChEMBL = 553204 | ChEBI_Ref = | ChEBI = 78420 | PubChem = 5318997 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 4477421 | Section2 = {{Chembox Properties | C=33 | H=40 | O=15 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
Icariin is a chemical compound classified as a prenylated flavonol glycoside, a type of flavonoid. It is the 8-prenyl derivative of kaempferol 3,7-O-diglucoside. The compound has been isolated from several species of plant belonging to the genus Epimedium which are commonly known as horny goat weed, Yin Yang Huo, and Herba epimedii. Extracts from these plants produce aphrodisiac effects, and are used in traditional Chinese medicine to enhance erectile function.
References
References
- (2006). "Optimization for quantitative determination of four flavonoids in Epimedium by capillary zone electrophoresis coupled with diode array detection using central composite design". [[J Chromatogr A]].
- (2011). "Icariin and its derivative icariside II extend healthspan via insulin/IGF-1 pathway in C. elegans". PLOS ONE.
- (2007). "Effect of lipid-based suspension of ''Epimedium koreanum Nakai'' extract on sexual behavior in rats". [[J Ethnopharmacol]].
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::