Ibrolipim

Quality 0.50 · 1 view · Updated 2 months ago

title: "Ibrolipim" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["statins", "bromoarenes", "nitriles", "benzanilides", "phosphonate-esters", "ethyl-esters"] topic_path: "general/statins" source: "https://en.wikipedia.org/wiki/Ibrolipim" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | verifiedrevid = 461775154 | ImageFile = Ibrolipim structure.svg | ImageClass = skin-invert-image | ImageSize = 120 | PIN = Diethyl ({4-[(4-bromo-2-cyanophenyl)carbamoyl]phenyl}methyl)phosphonate | OtherNames = |Section1={{Chembox Identifiers | UNII_Ref = | UNII = 07H1561618 | InChI = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) | InChIKey1 = KPRTURMJVWXURQ-UHFFFAOYSA-N | InChI1 = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) | CASNo_Ref = | CASNo = 133208-93-2 | PubChem = 131601 | ChemSpiderID_Ref = | ChemSpiderID = 116297 | KEGG_Ref = | KEGG = D03747 | StdInChIKey_Ref = | StdInChIKey = KPRTURMJVWXURQ-UHFFFAOYSA-N | SMILES = Brc2cc(C#N)c(NC(=O)c1ccc(cc1)CP(=O)(OCC)OCC)cc2 | StdInChI_Ref = | StdInChI = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |Section2={{Chembox Properties | Formula = C19H20BrN2O4P | MolarMass = 451.25 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

Ibrolipim (NO-1886) is a cholesterol lowering drug from the statin family, which acts as a lipoprotein lipase activator. The discovery of the "statin" mevalonic acid synthesis inhibitors focused new attention on control of blood lipid levels as a measure to stave off heart disease. A number of compounds have been found that treat elevated lipid levels by other diverse mechanisms. The phosphonic acid derivative ibrolipim is believed to lower those levels by accelerating fatty acid oxidation.

References

References

  1. (2003). "Lipoprotein lipase activator NO-1886". Cardiovascular Drug Reviews.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

statinsbromoarenesnitrilesbenzanilidesphosphonate-estersethyl-esters