Homprenorphine

Quality 0.50 · 1 view · Updated 2 months ago

Chemical compound

title: "Homprenorphine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["4,5-epoxymorphinans", "opioids", "tertiary-alcohols"] description: "Chemical compound" topic_path: "general/4-5-epoxymorphinans" source: "https://en.wikipedia.org/wiki/Homprenorphine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| IUPAC_name = 2-[17-(cyclopropylmethyl)-3,6-dimethoxy-7,8-didehydro-18,19-dihydro-4,5-epoxy-6,14-ethenomorphinan-18-yl]butan-2-ol | image = Homprenorphine.svg | image_class = skin-invert-image | CAS_number = 16549-56-7 | ATC_prefix = None | ATC_suffix = | UNII = SH57250J2D | PubChem = 3084250 | ChemSpiderID = 2341344 | ChEMBL = 2104317 | C = 28 | H = 37 | N = 1 | O = 4 | smiles = OC(C)(CC)C7CC63\C=C/C7(OC)C4Oc1c2c(ccc1OC)CC6N(CCC234)CC5CC5 | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration =

Homprenorphine (M-5202; R&S-5205-M) is an opioid analgesic of the thebaine series which was synthesized and assayed in 1967, but was not further studied and was never marketed.

References

References

  1. (1997). "Dictionary of pharmacological agents". CRC Press.
  2. (1999). "Concise dictionary of pharmacological agents: properties and synonyms". Springer.
  3. (February 2002). "British Approved Names 2002". The Stationery Office.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

4,5-epoxymorphinansopioidstertiary-alcohols