Halometasone

Quality 0.50 · 2 views · Updated 2 months ago

Chemical compound

title: "Halometasone" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["corticosteroids", "organochlorides", "organofluorides"] description: "Chemical compound" topic_path: "general/corticosteroids" source: "https://en.wikipedia.org/wiki/Halometasone" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = changed | IUPAC_name = (6α,11β,16α)-2-Chloro-6,9-difluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione | image = Halometasone.png | image_class = skin-invert-image | image2 = Halometasone cream.jpg | width = 200 | width2 = 200 | tradename = Sicorten | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Topical

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 50629-82-8 | ChEMBL_Ref = | ChEMBL = 1587228 | ATC_prefix = D07 | ATC_suffix = AC12 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = J69Z9UU41Z | PubChem = 9846332 | ChemSpiderID_Ref = | ChemSpiderID = 8022046 | smiles = O=C(CO)[C@]3(O)[C@]2(CC@H[C@]4(F)[C@@]/1(\C(=C/C(=O)C(\Cl)=C\1)C@@HC[C@H]4[C@@H]2C[C@H]3C)C)C | StdInChI_Ref = | StdInChI = 1S/C22H27ClF2O5/c1-10-4-11-12-5-15(24)13-6-16(27)14(23)7-19(13,2)21(12,25)17(28)8-20(11,3)22(10,30)18(29)9-26/h6-7,10-12,15,17,26,28,30H,4-5,8-9H2,1-3H3/t10-,11+,12+,15+,17+,19+,20+,21+,22+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = GGXMRPUKBWXVHE-MIHLVHIWSA-N

| C=22 | H=27 | Cl=1 | F=2 | O=5 | synonyms = (6S,8S,9R,10S,11S,13S,16R,17R)-2-chloro-6,9-difluoro-11,17-dihydroxy-17-(2-hydroxy-acetyl)-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one

Halometasone is a potent (Group III) synthetic tri-halogenated corticosteroid for topical application possessing pronounced anti-inflammatory, antiexudative, antiepidermoplastic, antiallergic, and antipruritic properties. It has been approved in many European countries including Spain, Germany, Switzerland, Austria, Netherlands, Belgium, and Portugal and other regions such as China, Hong Kong, Turkey, Israel, South Africa and India.

It has been used to treat chronic psoriasis vulgaris and non-infected acute eczematous dermatoses (eczema). One study demonstrated that 0.05% halometasone cream was more effective than 0.05% betamethasone cream in treating dermatitis, though both were well tolerated, with no systemic adverse effects reported.

References

References

  1. (1983). "Halometasone cream by day and halometasone ointment at night for the treatment of patients with chronic psoriasis vulgaris". The Journal of International Medical Research.
  2. (1983). "An overview of international clinical trials with halometasone cream". The Journal of International Medical Research.
  3. (February 1983). "[Comparative clinical trial of a new trihalogenated dermatocorticoid (halometasone) versus betamethasone dipropionate]". Zeitschrift für Hautkrankheiten.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

corticosteroidsorganochloridesorganofluorides