Guaiene

Quality 0.50 · 0 views · Updated 2 months ago

title: "Guaiene" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["sesquiterpenes"] topic_path: "general/sesquiterpenes" source: "https://en.wikipedia.org/wiki/Guaiene" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 459443626 | Name = Guaienes | ImageFileL1 = Alpha-guaiene.svg | ImageCaptionL1 = α-Guaiene | ImageFileR1 = Beta-guaiene.svg | ImageCaptionR1 = β-Guaiene | ImageFile2 = Delta-guaiene.svg | ImageSize2 = 100px | ImageCaption2 = δ-Guaiene | IUPACName = α: (1S,4S,7R)-1,4-Dimethyl-7-(prop-1-en-2-yl)-1,2,3,4,5,6,7,8-octahydroazulene β: (1S,4S)-1,4-Dimethyl-7-(propan-2-ylidene)-1,2,3,4,5,6,7,8-octahydroazulene δ: (3S,3aS,5R)-3,8-Dimethyl-5-(prop-1-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroazulene | OtherNames = Guajene |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 3691-12-1 | CASNo_Comment = (α) | CASNo1_Ref = | CASNo1 = 88-84-6 | CASNo1_Comment = (β) | CASNo2_Ref = | CASNo2 = 3691-11-0 | CASNo2_Comment = (δ) | UNII_Ref = | UNII = ABQ2CB7VAC | UNII_Comment = (α) | UNII1_Ref = | UNII1 = 1D018Q907T | UNII1_Comment = (β) | UNII2_Ref = | UNII2 = 2U8L6FYE8U | UNII2_Comment = (δ) | PubChem = 5317844 | PubChem_Comment = (α) | PubChem1 = 15560252 | PubChem1_Comment = (β) | PubChem2 = 94275 | PubChem2_Comment = (δ) | ChemSpiderID_Ref = | ChemSpiderID = 4476575 | ChemSpiderID_Comment = (α) | ChemSpiderID1_Ref = | ChemSpiderID1 = 16736689 | ChemSpiderID1_Comment = (β) | ChemSpiderID2_Ref = | ChemSpiderID2 = 85080 | ChemSpiderID2_Comment = (δ) | SMILES = C[C@H]1CCC2=C1CC@HCC[C@@H]2C | SMILES_Comment = (α) | SMILES1 = C[C@H]1CCC2=C1C/C(CC[C@@H]2C)=C(C)\C | SMILES1_Comment = (β) | SMILES2 = C[C@H]1CCC2=C(C)CCC@@HC[C@]21[H] | SMILES2_Comment = (δ) | InChI = 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+/m0/s1 | InChI_Comment = (α) | InChIKey = ADIDQIZBYUABQK-RWMBFGLXSA-N | InChI1 = 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-12H,5-9H2,1-4H3/t11-,12-/m0/s1 | InChI1_Comment = (β) | InChIKey1 = GIBQERSGRNPMEH-RYUDHWBXSA-N | InChI2 = 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h12-13,15H,1,5-9H2,2-4H3/t12-,13+,15-/m0/s1 | InChI2_Comment = (δ) | InChIKey2 = YHAJBLWYOIUHHM-GUTXKFCHSA-N |Section2={{Chembox Properties | C=15 | H=24 | Appearance = | Density = | MeltingPt = | BoilingPt = α: 281-282 °C α: 78-79 °C (@ 2.5 Torr) β: 281 °C | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }}

Guaienes are a series of closely related natural chemical compounds that have been isolated from a variety of plant sources. The guaienes are sesquiterpenes with the molecular formula C15H24. α-Guaiene is the most common and was first isolated from guaiac wood oil from Bulnesia sarmientoi. The guaienes are used in the fragrance and flavoring industries to impart earthy, spicy aromas and tastes.

References

References

  1. [http://www.thegoodscentscompany.com/data/rw1054351.html Alpha-guaiene], The Good Scents Company
  2. Takeda, Kenichi. (1961). "Studies on sesquiterpenoids—III, Some derivatives of guaiol". Tetrahedron.
  3. Won, Mi-Mi. (2009). "Analytica Chimica Acta".
  4. (1962). "Terpenoids. VI. β-Bulnesene, α-guaiene, β-patchoulene, and guaioxide in essential oils". Chemistry & Industry.
  5. [http://www.fao.org/ag/agn/agns/jecfa_index_en.asp Guaiene], Joint FAO/WHO Expert Committee on Food Additives

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

sesquiterpenes