Geranylgeraniol
title: "Geranylgeraniol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["diterpenes", "fatty-alcohols"] topic_path: "general/diterpenes" source: "https://en.wikipedia.org/wiki/Geranylgeraniol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| ImageFile = Geranylgeraniol.svg | ImageSize = 250px | PIN = (2E,6E,10E)-3,7,11,15-Tetramethylhexadeca-2,6,10,14-tetraen-1-ol | OtherNames = Tetraprenol |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 7614-21-3 | UNII_Ref = | UNII = AIA02AJA3A | PubChem = 5281365 | ChemSpiderID = 4444726 | ChEBI = 46762 | SMILES = OC/C=C(/CC/C=C(/CC\C=C(/C)CC\C=C(/C)C)C)C | InChI = 1/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+ | InChIKey = OJISWRZIEWCUBN-QIRCYJPOBA | StdInChI = 1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+ | StdInChIKey = OJISWRZIEWCUBN-QIRCYJPOSA-N |Section2={{Chembox Properties | C=20 | H=34 | O=1 | Appearance = colorless liquid | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
Geranylgeraniol is a diterpenoid alcohol. It is a colorless waxy solid.{{cite journal |doi=10.15227/orgsyn.084.0043|title=Stereoselective Isoprenoid Chain Extension with Acetoacetate Dianion: [(E, E, E)-Geranylgeraniol from (E, E)-Farnesol|journal=Organic Syntheses|year=2007|volume=84|page=43|first1=Yinghua|last1=Jin|first2=Frank G.|last2=Roberts|first3=Robert M.|last3= Coates
Geranylgeraniol is synthesized in humans through the mevalonate pathway.
As its pyrophosphate, it is also used in the post-translational modification by the process called geranylgeranylation.
Geranylgeraniol is a potent inhibitor of Mycobacterium tuberculosis in vitro.
References
References
- (2006). "Kirk-Othmer Encyclopedia of Chemical Technology".
- (2000-11-21). "Isoprenoid biosynthesis: The evolution of two ancient and distinct pathways across genomes". Proceedings of the National Academy of Sciences.
- (2004-04-01). "Isoprenoids: Remarkable diversity of form and function". Lipids.
- (2007). "Screening of terpenes and derivatives for antimycobacterial activity; identification of geranylgeraniol and geranylgeranyl acetate as potent inhibitors of Mycobacterium tuberculosis in vitro". Planta Medica.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::