Galanolactone

title: "Galanolactone" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["furanones", "diterpenes", "decalins", "epoxides", "tetrahydrofurans", "spiro-compounds"] topic_path: "general/furanones" source: "https://en.wikipedia.org/wiki/Galanolactone" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 430147541 | Name = Galanolactone | ImageFile = Galanolactone.svg | ImageSize = 200px | ImageName = Galanolactone | PIN = (3E)-3-{2-[(1R,2S,4aS,8aS)-5,5,8a-Trimethyloctahydro-1H-spiro[naphthalene-2,2′-oxiran]-1-yl]ethylidene}oxolan-2-one | OtherNames = |Section1={{Chembox Identifiers | CASNo = 115753-79-2 | CASNo_Ref = | UNII_Ref = | UNII = 4FX4852TYQ | PubChem = 11141699 | ChemSpiderID_Ref = | ChemSpiderID = 9316811 | SMILES = O=C/1OCCC\1=C\C[C@@H]4[C@@]2(C@HCC[C@]43OC3)C | StdInChI_Ref = | StdInChI = 1S/C20H30O3/c1-18(2)9-4-10-19(3)15(18)7-11-20(13-23-20)16(19)6-5-14-8-12-22-17(14)21/h5,15-16H,4,6-13H2,1-3H3/b14-5+/t15-,16+,19-,20+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = MBPTXJNHCBXMBP-SDIIOJARSA-N | MeSHName = galanolactone |Section2={{Chembox Properties | Formula = C20H30O3 | MolarMass = 318.45 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = | SolubleOther = Soluble | Solvent = acetone
Galanolactone is a diterpenoid lactone first isolated from ginger. It is present in acetone extracts of ginger, and appears to be an antagonist at 5-HT3 receptors.{{Cite journal | journal = Chemical & Pharmaceutical Bulletin | pages = 397–399 | issue = 2 | volume = 39 | title = Anti-5-hydroxytryptamine3 effect of galanolactone, diterpenoid isolated from ginger | last3 = Aoki | first10 = Y. | last2 = Iwamoto | last10 = Tamai | last1 = Huang | first3 = S. | year = 1991 | pmid = 2054863 | first9 = T. | last4 = Tanaka | first4 = N. | last8 = Yoshida | first7 = Y. | last5 = Tajima | first8 = M. | first5 = K. | last7 = Takaishi | first6 = J. | last6 = Yamahara | last9 = Tomimatsu | first1 = Q. | first2 = Y. | doi=10.1248/cpb.39.397 | doi-access = free
References
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::