Galangin

Quality 0.50 · 2 views · Updated 2 months ago

title: "Galangin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["flavonols", "resorcinols", "steroid-sulfotransferase-inhibitors", "triols"] topic_path: "general/flavonols" source: "https://en.wikipedia.org/wiki/Galangin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Watchedfields = changed | verifiedrevid = 443831073 | Name = Galangin | ImageFile = Galangin.svg | ImageSize = 220px | ImageAlt = Skeletal formula of galangin | ImageFile1 = Galangin-3D-balls.png | ImageAlt1 = Ball-and-stick model of the galangin molecule | IUPACName = 3,5,7-Trihydroxyflavone | SystematicName = 3,5,7-Trihydroxy-2-phenyl-4H-1-benzopyran-4-one | OtherNames = Norizalpinin 3,5,7-triOH-Flavone |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 4444935 | KEGG_Ref = | KEGG = C10044 | InChI = 1/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H | InChIKey = VCCRNZQBSJXYJD-UHFFFAOYAC | ChEMBL_Ref = | ChEMBL = 309490 | StdInChI_Ref = | StdInChI = 1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H | StdInChIKey_Ref = | StdInChIKey = VCCRNZQBSJXYJD-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 548-83-4 | PubChem = 5281616 | IUPHAR_ligand = 410 | UNII_Ref = | UNII = 142FWE6ECS | ChEBI_Ref = | ChEBI = 5262 | SMILES = O=C1c3c(O/C(=C1/O)c2ccccc2)cc(O)cc3O |Section2={{Chembox Properties | C=15 | H=10 | O=5 | Density = 1.579 g/mL | MeltingPtC = 214 to 215 | MeltingPt_notes = | BoilingPt =

Galangin is a flavonol, a type of flavonoid.

Occurrence

Galangin is found in high concentrations in plants like Alpinia officinarum (lesser galangal) and Helichrysum aureonitens. It is also found in the rhizome of Alpinia galanga{{Cite journal | last1 = Kaur | first1 = A. | last2 = Singh | first2 = R. | last3 = Dey | first3 = C. S. | last4 = Sharma | first4 = S. S. | last5 = Bhutani | first5 = K. K. | last6 = Singh | first6 = I. P. | title = Antileishmanial phenylpropanoids from Alpinia galanga (Linn.) Willd | journal = Indian Journal of Experimental Biology | volume = 48 | issue = 3 | pages = 314–317 | year = 2010 | pmid = 21046987 | url = http://nopr.niscair.res.in/bitstream/123456789/7407/1/IJEB%2048(3)%20314-317.pdf

Biological activities

Galangin has been shown to have in vitro antibacterial and antiviral activity. It also inhibits the growth of breast tumor cells in vitro.{{Cite journal | last1 = So | first1 = F. V. | last2 = Guthrie | first2 = N. | last3 = Chambers | first3 = A. F. | last4 = Moussa | first4 = M. | last5 = Carroll | first5 = K. K. | title = Inhibition of human breast cancer cell proliferation and delay of mammary tumorigenesis by flavonoids and citrus juices | doi = 10.1080/01635589609514473 | journal = Nutrition and Cancer | volume = 26 | issue = 2 | pages = 167–181 | year = 1996 | pmid = 8875554

References

References

  1. (1999). "The flavonoid galangin is an inhibitor of CYP1A1 activity and an agonist/antagonist of the aryl hydrocarbon receptor". British Journal of Cancer.
  2. (1997). "The antimicrobial activity of 3,5,7-trihydroxyflavone isolated from the shoots of Helichrysum aureonitens". Journal of Ethnopharmacology.
  3. (2007). "Food preservative based on propolis: Bacteriostatic activity of propolis polyphenols and flavonoids upon Escherichia coli". Food Chemistry.
  4. (2006). "Assessment of the antibacterial activity of galangin against 4-quinolone resistant strains of Staphylococcus aureus". Phytomedicine.
  5. (2005). "Detection of galangin-induced cytoplasmic membrane damage in Staphylococcus aureus by measuring potassium loss". Journal of Ethnopharmacology.
  6. (2024-09-02). "Dual-species proteomics and targeted intervention of animal-pathogen interactions". Journal of Advanced Research.
  7. (1997). "Antiviral activity of galangin isolated from the aerial parts of Helichrysum aureonitens". Journal of Ethnopharmacology.
  8. (1997). "Inhibition of proliferation of estrogen receptor-positive MCF-7 human breast cancer cells by flavonoids in the presence and absence of excess estrogen". Cancer Letters.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

flavonolsresorcinolssteroid-sulfotransferase-inhibitorstriols