Fenspiride

Chemical compound
title: "Fenspiride" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["2-oxazolidinones", "alpha-1-blockers", "bronchodilators", "phenethylamines", "spiro-compounds", "withdrawn-drugs"] description: "Chemical compound" topic_path: "general/2-oxazolidinones" source: "https://en.wikipedia.org/wiki/Fenspiride" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 406208293
| IUPAC_name = 8-(2-phenylethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one
| image = Fenspiride.svg
| image_class = skin-invert-image
| width = 200
| image2 = Fenspiride ball-and-stick model.png
| image_class2 = bg-transparent
| width2 = 230
| tradename = Eurespal, Pneumorel
| Drugs.com =
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability = 90%
| metabolism =
| elimination_half-life = 14–16 hours
| excretion = Urine (90%), feces (~10%)
| CAS_number_Ref =
| CAS_number = 5053-06-5
| ATC_prefix = R03
| ATC_suffix = BX01
| ATC_supplemental =
| PubChem = 68626
| DrugBank_Ref =
| DrugBank = DB08979
| UNII_Ref =
| UNII = S983QC7HKM
| KEGG_Ref =
| KEGG = D07949
| ChEMBL_Ref =
| ChEMBL = 576127
| ChemSpiderID_Ref =
| ChemSpiderID = 3227
| C=15 | H=20 | N=2 | O=2 | smiles = c1ccc(cc1)CCN2CCC3(CC2)CN=C(O3)O | StdInChI_Ref = | StdInChI = 1S/C15H20N2O2/c18-14-16-12-15(19-14)7-10-17(11-8-15)9-6-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,16,18) | StdInChIKey_Ref = | StdInChIKey = FVNFBBAOMBJTST-UHFFFAOYSA-N
Fenspiride (INN, brand names Eurespal, Pneumorel and others) is an oxazolidinone spiro compound used as a drug in the treatment of certain respiratory diseases. The pharmacotherapeutic classification is antitussives. In Russia it was approved for the treatment of acute and chronic inflammatory diseases of ENT organs (ear, nose, throat) and the respiratory tract (like rhinopharyngitis, laryngitis, tracheobronchitis, otitis and sinusitis), as well as for maintenance treatment of asthma. Russia, Romania, France and other European countries withdrew fenspiride-based drugs from the market due to the risk of QT prolongation and torsades de pointes. Fenspiride is known to have activity as an alpha-1 blocker, H1 antagonist, it also inhibits PDE3, PDE4, PDE5 with -logIC50 values of 3.44, 4.16, 3.8 respectively.
References
References
- (1993). "Single dose pharmacokinetics of fenspiride hydrochloride: phase I clinical trial". European Journal of Clinical Pharmacology.
- (December 1998). "[Efficacy and tolerance of fenspiride in adult patients with acute respiratory tract infections]". Polski Merkuriusz Lekarski.
- "Эреспал (Eurespal) Prescribing Information. VIDAL Drug Compendium".
- (2019-02-15). "Fenspiride containing medicinal products".
- (September 2002). "[ENT inflammation and importance of fenspiride]". Presse Med.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::