Dynorphin B


title: "Dynorphin B" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["neuropeptides", "kappa-opioid-receptor-agonists", "opioid-peptides"] topic_path: "general/neuropeptides" source: "https://en.wikipedia.org/wiki/Dynorphin_B" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 428952076 | ImageFile=Dynorphin B.svg | ImageClass = skin-invert-image | ImageSize=300px | IUPACName= | OtherNames= Dynorphin B-13; Rimorphin | Reference= |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo=85006-82-2 | UNII_Ref = | UNII = K41YC3AEI8 | PubChem=16133806

| ChemSpiderID_Ref = | ChemSpiderID = 17299995 | SMILES = [H]/N=C(\N)/NCCCC@@HNC(=O)C@HNC(=O)C@HNC(=O)C@HNC(=O)CNC(=O)CNC(=O)C@HN | InChI = 1/C74H115N21O17/c1-40(2)34-53(91-68(107)54(36-44-18-10-8-11-19-44)86-58(100)39-84-57(99)38-85-62(101)48(76)35-46-25-27-47(97)28-26-46)67(106)89-51(24-17-33-83-74(80)81)63(102)87-50(23-16-32-82-73(78)79)64(103)90-52(29-30-56(77)98)65(104)92-55(37-45-20-12-9-13-21-45)69(108)88-49(22-14-15-31-75)66(105)93-59(41(3)4)70(109)94-60(42(5)6)71(110)95-61(43(7)96)72(111)112/h8-13,18-21,25-28,40-43,48-55,59-61,96-97H,14-17,22-24,29-39,75-76H2,1-7H3,(H2,77,98)(H,84,99)(H,85,101)(H,86,100)(H,87,102)(H,88,108)(H,89,106)(H,90,103)(H,91,107)(H,92,104)(H,93,105)(H,94,109)(H,95,110)(H,111,112)(H4,78,79,82)(H4,80,81,83)/t43-,48+,49+,50+,51+,52+,53+,54+,55+,59+,60+,61+/m1/s1 | InChIKey = AGTSSZRZBSNTGQ-ITZCFHCWBN | StdInChI_Ref = | StdInChI = 1S/C74H115N21O17/c1-40(2)34-53(91-68(107)54(36-44-18-10-8-11-19-44)86-58(100)39-84-57(99)38-85-62(101)48(76)35-46-25-27-47(97)28-26-46)67(106)89-51(24-17-33-83-74(80)81)63(102)87-50(23-16-32-82-73(78)79)64(103)90-52(29-30-56(77)98)65(104)92-55(37-45-20-12-9-13-21-45)69(108)88-49(22-14-15-31-75)66(105)93-59(41(3)4)70(109)94-60(42(5)6)71(110)95-61(43(7)96)72(111)112/h8-13,18-21,25-28,40-43,48-55,59-61,96-97H,14-17,22-24,29-39,75-76H2,1-7H3,(H2,77,98)(H,84,99)(H,85,101)(H,86,100)(H,87,102)(H,88,108)(H,89,106)(H,90,103)(H,91,107)(H,92,104)(H,93,105)(H,94,109)(H,95,110)(H,111,112)(H4,78,79,82)(H4,80,81,83)/t43-,48+,49+,50+,51+,52+,53+,54+,55+,59+,60+,61+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = AGTSSZRZBSNTGQ-ITZCFHCWSA-N

|Section2={{Chembox Properties | C=74 | H=115 | N=21 | O=17 | MolarMass=1570.8354 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt =

Dynorphin B, also known as rimorphin, is a form of dynorphin and an endogenous opioid peptide with the amino acid sequence Tyr-Gly-Gly-Phe-Leu-Arg-Arg-Gln-Phe-Lys-Val-Val-Thr (YGGFLRRQFKVVT). Dynorphin B is generated as a proteolytic cleavage product of leumorphin, which in turn is a cleavage product of preproenkephalin B (prodynorphin).

Dynorphin B has an identical N-terminal sequence, but different C-terminal sequence to dynorphin A. In an alanine scan of the non-glycine residues of dynorphin B, it was discovered that Tyr1 and Phe4 residues are critical for both opioid receptor affinity and κ-opioid receptor agonist potency, Arg6 and Arg7 promote κ-opioid affinity and Lys10 contributes to the opioid receptor affinity.

Inducers of dynorphin B

Cannabinoid CP55,940 and △9-tetrahydrocannabinol (△9-THC) can induce the release of dynorphin B, which in return acts as an agonist of κ-opioid receptors, resulting in the production of antinociception. Similarly, Tyr-D-Arg-Phe-Sar (TAPS) is capable of promoting a release of dynorphin B through the simulation of μ1-opioid receptors, causing a production of antinociception. The antinociceptive effect produced by dynorphin B allows for spinal analgesia.

References

References

  1. [https://pubchem.ncbi.nlm.nih.gov/compound/16133806 Dynorphin B - Compound Summary], [[PubChem]].
  2. Paul V. Malven. (12 January 1993). "Mammalian Neuroendocrinology". CRC Press.
  3. (September 2017). "Alanine scan of the opioid peptide dynorphin B amide". Biopolymers.
  4. (February 2000). "Dynorphin B and spinal analgesia: induction of antinociception by the cannabinoids CP55,940, Δ9-THC and anandamide1Published on the World Wide Web on 18 January 2000.1". Brain Research.
  5. (November 2006). "Contribution of spinal μ1-opioid receptors and dynorphin B to the antinociception induced by Tyr-d-Arg-Phe-Sar". Peptides.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

neuropeptideskappa-opioid-receptor-agonistsopioid-peptides