DPPH


title: "DPPH" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["free-radicals"] topic_path: "general/free-radicals" source: "https://en.wikipedia.org/wiki/DPPH" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Watchedfields = changed | verifiedrevid = 441743867 | Name = | ImageFile = DPPH.svg | ImageSize = 220 | ImageAlt = Skeletal formula of DPPH | ImageFile1 = Dpph sample.jpg | ImageSize1 = 220 | ImageAlt1 = sample | PIN = 2,2-Diphenyl-1-(2,4,6-trinitrophenyl)hydrazin-1-yl | OtherNames = 2,2-Diphenyl-1-picrylhydrazyl 1,1-Diphenyl-2-picrylhydrazyl radical 2,2-Diphenyl-1-(2,4,6-trinitrophenyl)hydrazyl Diphenylpicrylhydrazyl | Section1 = {{Chembox Identifiers | Abbreviations = DPPH | ChemSpiderID_Ref = | ChemSpiderID = 2016757 | InChIKey = WCBPJVKVIMMEQC-UHFFFAOYAG | InChI1 = 1/C18H12N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H | InChIKey1 = HHEAADYXPMHMCT-UHFFFAOYAG | StdInChI_Ref = | StdInChI = 1S/C18H12N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H | StdInChIKey_Ref = | StdInChIKey = HHEAADYXPMHMCT-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 1898-66-4 | UNII_Ref = | UNII = DFD3H4VGDH | EINECS = | PubChem = 74358 | SMILES = c1ccc(cc1)N(c2ccccc2)[N]c3c(cc(cc3N+[O-])N+[O-])N+[O-] | InChI = 1/C18H13N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,19H | Section2 = {{Chembox Properties | C = 18 | H = 12 | N = 5 | O = 6 | Appearance = Black to green powder, purple in solution | Density = 1.4 g/cm3 | MeltingPtC = 135 | MeltingPt_notes = (decomposes) | BoilingPtC = | BoilingPt_notes = | Solubility = insoluble | Solubility1 = 10 mg/mL | Solvent1 = methanol | Solvent = alcohol, acetone | pKa = | pKb =}} | Section3 = | Section4 = | Section5 = | Section6 = | Section7 = {{Chembox Hazards | MainHazards = | ExternalSDS = MSDS | NFPA-H = 0 | NFPA-F = 1 | NFPA-R = 0 | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | PEL =}}

DPPH (2,2-diphenyl-1-picrylhydrazyl) is an organic chemical compound. It is a dark-colored crystalline powder composed of stable free radical molecules. DPPH has two major applications, both in laboratory research: one is a monitor of chemical reactions involving radicals, most notably it is a common antioxidant assay, and another is a standard of the position and intensity of electron paramagnetic resonance signals.

Properties and applications

DPPH has several crystalline forms which differ by the lattice symmetry and melting point. The commercial powder is a mixture of phases which melts at ~130 °C. DPPH-I (m.p. 106 °C) is orthorhombic, DPPH-II (m.p. 137 °C) is amorphous and DPPH-III (m.p. 128–129 °C) is triclinic.

DPPH is a well-known radical and a trap ("scavenger") for other radicals. Therefore, rate reduction of a chemical reaction upon addition of DPPH is used as an indicator of the radical nature of that reaction. Because of a strong absorption band centered at about 520 nm, the DPPH radical has a deep violet color in solution, and it becomes colorless or pale yellow when neutralized. This property allows visual monitoring of the reaction, and the number of initial radicals can be counted from the change in the optical absorption at 520 nm or in the EPR signal of the DPPH.

:[[File:DPPHreact.png|500px]]

Because DPPH is an efficient radical trap, it is also a strong inhibitor of radical-mediated polymerization. :[[File:Termination - with impurity 2.png|thumb|500px|left|Inhibition of polymer chain, R, by DPPH.]] As a stable and well-characterized solid radical source, DPPH is the traditional and perhaps the most popular standard of the position (g-marker) and intensity of electron paramagnetic resonance (EPR) signals – the number of radicals for a freshly prepared sample can be determined by weighing and the EPR splitting factor for DPPH is calibrated at g = 2.0036. DPPH signal is convenient by that it is normally concentrated in a single line, whose intensity increases linearly with the square root of microwave power in the wider power range. The dilute nature of the DPPH radicals (one unpaired spin per 41 atoms) results in a relatively small linewidth (1.5–4.7 G). The linewidth may however increase if solvent molecules remain in the crystal and if measurements are performed with a high-frequency EPR setup (~200 GHz), where the slight g-anisotropy of DPPH becomes detectable.

Whereas DPPH is normally a paramagnetic solid, it transforms into an antiferromagnetic state upon cooling to very low temperatures of the order 0.3 K. This phenomenon was first reported by Alexander Prokhorov in 1963.

References

References

  1. (15 April 2009). "DPPH antioxidant assay revisited". Journal of Food Chemistry.
  2. (1976). "The crystal structure of a 2,2-diphenyl-1-picrylhydrazyl (DPPH) modification". Acta Crystallographica Section B.
  3. Alger, Mark S. M.. (1997). "Polymer science dictionary". Springer.
  4. Cowie, J. M. G.. (2008). "Polymers: Chemistry and Physics of Modern Materials". CRC Press.
  5. M.J. Davies. (2000). "Electron Paramagnetic Resonance". Royal Society of Chemistry.
  6. Charles P. Poole. (1996). "Electron spin resonance: a comprehensive treatise on experimental techniques". Courier Dover Publications.
  7. A. M. Prokhorov and V.B. Fedorov, Soviet Phys. JETP 16 (1963) 1489.
  8. Fujito, Teruaki. (1981). "Magnetic Interaction in Solvent-free DPPH and DPPH–Solvent Complexes". Bulletin of the Chemical Society of Japan.
  9. Lundqvist, Stig. (1998). "Nobel Lectures in Physics, 1963–1970". World Scientific.
  10. [http://nobelprize.org/nobel_prizes/physics/laureates/1964/prokhorov-bio.html Aleksandr M. Prokhorov, The Nobel Prize in Physics 1964]

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

free-radicals